Answer:
97.2°
Step-by-step explanation:
yw
The degree measure for the sector for the Navy be in a circle graph is 118.80.
What is angle of a sector ?"The angle of the sector is 360°, area of the sector, i.e. the Whole circle = πr2. When the Angle is 1°, area of sector = πr2/360° So, when the angle is θ, area of sector, OPAQ, is defined as; A = (θ/360°) × πr2."
Given here,
Navy = 165 members
Total members = 495
So, navy percentage in the circle is [tex]\165*495/ 100 = 27.27[/tex]
And, angle of the sector of Navy is = [tex]27.27*360/100[/tex] = 118.80
Hence, option D is correct.
To know know about degree measure here
https://brainly.com/question/23924161
#SPJ2
A line representing Car B would have a parallel slope if:
Answer:
you add an image
Step-by-step explanation:
Answer:
... if it had the same slope in the y=mx+b equation where m is the slope and x is just x and b is the y-intercept
Step-by-step explanation:
say Car A had the equation y=2x+3- Car B would also have to have be y=2x but the y intercept could be any value
PLEASE HELP MEEEEEEE! JUSTIFY
Answer:
Step-by-step explanation:
a.12÷36/7=7/3
12*7/36
84/36
7/3
b.let the number be x
x*1/2=x/2
x*1/2
x/2
A- True
12÷36/7 = 2.333...
7/3 = 2.333....
Hence it's true
B- True
Consider Any random number eg 10
multiplying it by 1/2 gives 5
and dividing by 2 also gives 5
hence it's true.
C- False
3/2 = 1.5
multiplying it to any number will produce half of the number more.
Cedar Point has 17 roller coasters. If you want to ride at least 15 of them, how many different combinations of roller coasters can you ride? NO LINKS!!!
================================================
Explanation:
I'll be using the formula
[tex]_n C _r = \frac{n!}{r!*(n-r)!}[/tex]
which is the nCr combination formula. We use nCr instead of nPr because the order of coasters doesn't matter. The whole time, the value of n stays fixed at n = 17 which is the total number of coasters to pick from.
While n is constant, the value of r will vary. It ranges from r = 15 to r = 17 inclusive of both endpoints. In other words, r will take on values from the set {15,16,17}. So we have three cases to consider. The r value is how many coasters we select. This is due to the "at least 15" which means "15 or more".
-----------------------
If you ride r = 15 coasters, then we have the following number of combinations
[tex]_n C _r = \frac{n!}{r!*(n-r)!}\\\\_{17} C _{15} = \frac{17!}{15!*(17-15)!}\\\\_{17} C _{15} = \frac{17!}{15!*2!}\\\\_{17} C _{15} = \frac{17*16*15!}{15!*2!}\\\\_{17} C _{15} = \frac{17*16}{2!}\\\\_{17} C _{15} = \frac{17*16}{2*1}\\\\_{17} C _{15} = \frac{272}{2}\\\\_{17} C _{15} = 136\\\\[/tex]
There are 136 ways to ride exactly 15 coasters (when selecting from a pool of 17 total). The order doesn't matter.
We'll use this result later, so let x = 136.
-----------------------
If r = 16, then we follow the same steps as above. You should get 17C16 = 17
There are 17 ways to ride 16 coasters where order doesn't matter. Effectively this is the same as saying "there are 17 ways of picking a coaster that you won't ride"
Let y = 17 so we can use it later
-----------------------
Lastly, if r = 17, then nCr = 17C17 = 1 represents one way to ride all 17 coasters where order doesn't matter.
Let z = 1
-----------------------
Add up the values of x, y, and z to get the final answer
x+y+z = 136+17+1 = 154
Jerome purchased a 4-year old car for $12,000. He was told this make a model depreciates exponentially at a rate of 5.7% each year. What was the original price to the nearest hundred dollars?
Group of answer choices
$19,300
$15,200
$12,500
$17,500
The number of new customers n that visit a dry cleaning shop in one year is directly related to the
amount a in dollars) spent on advertising. This relationship is represented by n3 = 13,824a. To
attract 480 new customers, how much should the owners spend on advertising during the year?
Answer:
$15,264 cost amount on new advertising.
Shown as new equation that includes (original + new customer base)
n3=15264a
Step-by-step explanation:
First we have to find original amount of customers as 3 represents a multiple of n
n3=13824a
n3 means n x 3 then customer base is one third
= 1/3 x 13,824 = 4608 original customers per year
= 4608 original customers +480 new customers
4608 + 480 = 5088 total orig+initial customers
5088 x 3 = 15264 cost
= ($)15,264 cost
new equation
n3=15264a
PLEASE HELP I WILL MARK BRAINLIST
Answer:
the are would be 18
Step-by-step explanation:
bc 2x3=6 and then 4x3=12 so 12+6=18
Simplify: 3-2
A. -9
B. -6
C.1/9
D.1/6
Answer:
1/9
Step-by-step explanation:
3 ^ -2
The negative in the exponent means to bring it to the denominator
1/ 3^2
1/9
Answer:
C. 1/9
Step-by-step explanation:
PLEASE HELP!!
The domain of a function f(x) is x <_ 0, and the range is y <_-1. What are the domain and range of its inverse function, f-1(x)?
Answer:
Option D.
Step-by-step explanation:
Domain and range of inverse function:
The domain of the inverse function(x values) is the range(y values) of the original function.
The range of the interse function(y values) is the domain of the original function(x values).
Original function:
Domain: [tex]x \geq 0[/tex]
Range: [tex]y \leq -1[/tex]
Inverse function:
x values in the domain of the inverse function are the y values in the range of the original function. So
Domain: [tex]x \leq 1[/tex]
Same for range(exchange of y and x).
Range: [tex]y \geq 0[/tex]
The answer is given by option D.
NEED HELP ASAP OR NOW!!!
1. Which of the following statements best represents the graph?
A. After one month of service, the cost of internet is $45.
B. After 60 months of service, the cost of internet is $1.
C. After one months of service, the cost of internet is $60.
D. After 5 months of service, the cost of internet is $210.
PLEASE ALSO ANSWER THE QUESTION BELOW.
2. Which is the correct equation best reflects to the graph above on question 1?
A. Y = 90x
B. Y = 180x
C. Y = 45x
D. Both B and C

Reflect (‐10,4) across the x‐axis what is the reflected ordered pair
Answer:
(-10, -4)
Step-by-step explanation:
That is the ordered pair
if teen romance had 20% in a circle graph and 4,000 books were signed out in the summer how many of them were teen romance
Answer:
800 Books were signed out
Step-by-step explanation:
20% of 4000 is 800
Hi there!
»»————- ★ ————-««
I believe your answer is:
800 books.
»»————- ★ ————-««
Here’s why:
As mentioned in the question, there are 4,000 books signed out during the summer.20% out of the 4,000 were teen romance books.⸻⸻⸻⸻
[tex]\boxed{\text{20 Percent of 4,000:}}\\\\\rightarrow 4,000* (20/100)\\\\\rightarrow \boxed{800}[/tex]
⸻⸻⸻⸻
There should be 800 books that were teen romance.
»»————- ★ ————-««
Hope this helps you. I apologize if it’s incorrect.
You deposit $500 in an investment account. The rate of growth is 6% a year. If you make no further deposits or withdrawals, and the investment is allowed to grow uninhibited, how long will it take for your investment to reach $1,500? Round to the nearest tenth.
A. 18.3 years
B. 45.1 years
C. 27.6 years
D. 8.0 years
With the given compound interest of 6% per year to reach the investment at $1500, it will take 18.3. years thus option (A) is correct.
What is compound interest?Compound interest is applicable when there will be a change in principal amount after the given time period.
For example, if you give anyone $500 at the rate of 10% annually then $500 is your principle amount. After 1 year the interest will be $50 and hence principle amount will become $550.
As per the given,
Principle amount P = $500
Rate of interest r = 6% annually
Total investment = P(1 + r)^T
1500 = 500(1 + 0.06)^T
300 = 1.06^T
Take natural logs on both sides
ln300 = T ln1.06
T = 18.3 years
Hence "With the given compound interest of 6% per year to reach the investment at $1500, it will take 18.3. years".
For more information about compound interest,
brainly.com/question/26457073
#SPJ2
2) Use the law of sines to find the length of SR
sin(A)/a=sin(B)/b=sin(C)/c
Answer:
take 28 degree as reference angle
using sine angle
sin28=p/h
0.46=10/h
0.46h=10
h=10/0.46
h=21.73
therefore hypotenuse =21.73
again using sine rule
take 25 degree as reference angle
sin 25=p/h
0.42=SR/21.73
0.42*21.73=SR
9.12=SR
9.1=SR
Step-by-step explanation:
A test of abstract reasoning is given to a random sample of students before and after they completed a formal logic course. The results are given below. Construct a 95% confidence interval for the mean difference between the before and after scores. Is there evidence to suggest the logic course improves abstract reasoning? You may assume that the differences for the dependent samples are normally distributed.
Before 74, 83, 75, 88, 84, 63, 93, 84, 91, 77
After 73, 77, 70, 77, 74, 67, 95, 83, 84, 75
Note : define d = before - after, then đ = 3.7 and s = 4.95
Answer:
The right answer is "[tex]0.2<\mu d<7.2[/tex]".
Step-by-step explanation:
The given values are:
[tex]\bar{x_0} = 3.7[/tex]
[tex]s_o=4.95[/tex]
[tex]t_{\frac{0.05}{2} }=2.2621[/tex]
As we know,
95% confidence for [tex]\mu_0[/tex] will be:
= [tex]\bar{x_0} \pm t_{\frac{0.05}{2} },n-1\times \frac{s_o}{\sqrt{n} }[/tex]
The lower bound will be:
= [tex]3.7-2.2621\times \frac{4.95}{\sqrt{10} }[/tex]
= [tex]0.16\simeq 0.2[/tex]
The upper bound will be:
= [tex]3.7+2.2621\times \frac{4.95}{\sqrt{10} }[/tex]
= [tex]7.23\simeq7.2[/tex]
Thus the right answer is "[tex]0.2<\mu d<7.2[/tex]"
Segment AB is a ____
Define the term volume
Answer:
Volume: The space which fills up a certain object on the inside.
I need the answer fast pls
Answer:
Option A, 1/8 pound would be the correct answer
Step-by-step explanation:
Since mode of the data is the number in the data that occurs the most, if noticed 1/8 occurs 4 times in the data set given and hence is the mode of the data set
Hope this helps!
prove that; tan20+4sin20= square root of3
tan( 20 ) + 4 Sin( 20 ) =
( Sin( 20 ) / Cos( 20 ) ) + 4 Sin( 20 ) =
Sin( 20 ) + 4 Sin( 20 ).Cos( 20 ) / Cos( 20 ) =
Sin( 20 ) + 2 × 2 Sin(20).Cos(20)/ Cos(20) =
Sin( 20 ) + 2 × Sin( 40 ) / Cos( 20 ) =
Sin( 20 ) + 2Sin( 40 ) / Cos( 20 ) =
Sin( 20 ) + 2Cos( 50 ) / Cos ( 20 ) =
Sin( 20 ) + 2Cos( 20 + 30 ) / Cos( 20 ) =
________________________________
2 × Cos( 30 + 20 ) =
2 × [ Cos(30).Cos(20) - Sin(30).Sin(20) ] =
2 × [ √3/2 × Cos(20) - 1/2 × Sin(20) ] =
√3 Cos(20) - Sin(20)
_________________________________
Sin( 20 ) + 2Cos ( 20 + 30 ) / Cos( 20 ) =
Sin( 20 ) + √3 Cos(20) - Sin(20) / Cos(20) =
Sin(20) - Sin(20) + √3 Cos(20) / Cos(20) =
0 + √3 Cos(20) / Cos(20) =
√3 Cos(20) / Cos(20) =
Cos(20) simplifies from the numerator and denominator of fraction
√3 × 1 / 1 =
√3
And we're done ....
Helaine graphed the equation 12x−4y=3. What was the slope of Helaine’s line?
Answer:
The slope is 3
Step-by-step explanation:
12x−4y=3
Solve for y
Subtract 12x from each side
-12x +12x−4y=-12x+3
-4y = 12x+3
Divide each side by -4
-4y/-4 = -12x / -4 +3/-4
y = 3x -3/4
This is in slope intercept form
y = mx+b where m is the slope and b is the y intercept
The slope is 3
Answer:
The slope is 3
Step-by-step explanation:
12x−4y=3
Solve for y
Subtract 12x from each side
-12x +12x−4y=-12x+3
-4y = 12x+3
Divide each side by -4
-4y/-4 = -12x / -4 +3/-4
y = 3x -3/4
This is in slope intercept form
y = mx+b where m is the slope and b is the y intercept
The slope is 3
Find the multiplicative inverse of:
[tex]4 \times \frac{ - 7}{8} [/tex]
[tex] \frac{ - 5}{6} \times \frac{2}{7} [/tex]
Answer:
Step-by-step explanation:
first no answer=1/4*8/-7 =8/-28
second no answer=6/-5*7/2 =42/-10
Write the equation of the linear relationship in slope-intercept form.
Answer:
y = 1/3x + 70/3
Step-by-step explanation:
2 points on the graph:
(20, 30) and (50, 40)
Slope:
m=(y2-y1)/(x2-x1)
m=(40 - 30)/(50 - 20)
m= 10/30
m= 1/3
Slope-intercept:
y - y1 = m(x - x1)
y - 30 = 1/3(x - 20)
y - 30 = 1/3x - 20/3
y = 1/3x + 70/3
a box is created from a sheet of cardboard 40in. on a side by cutting a square from each corner and folding up the sides. let x represent the lenght pf the sides of squares removed from each corner.
What are the factors of this polynomial?
Step-by-step explanation:
Given that,
A box is created from a sheet of cardboard 40in. on a side by cutting a square from each corner and folding up the sides.
Let x represent the length of the sides of squares removed from each corner.
(a) The volume of a cuboid is given by :
V = lbh
Put values,
V = x(40-2x)(40-2x)
(b) (40-2x) = -2(x-20)
So,
V = x(40-2x)(40-2x)
= [tex]4x\left(x-20\right)^2[/tex]
(c) [tex]4x\left(x-20\right)^2=4x^3-160x^2+1600x[/tex]
It is a cubic polynomial. Its degree is 3.
Need help with this question. 20 points
9514 1404 393
Answer:
3
Step-by-step explanation:
For x > 0, the function f(x) is ...
f(x) = 3x -4 . . . . . . . . for x > 0
Translating this down 1 unit makes it ...
g(x) = f(x) -1 = 3x -5
The rate of change for any interval such that x > 0 in the whole interval is the coefficient of x: 3.
The rate of change on the interval is 3.
__
If you like, you can find the rate of change from ...
m = (g(5) -g(2))/(5 -2) = (10 -1)/3 = 9/3 = 3
The rate of change is 3.
Hey guys can u please help me asap
Oil from uncapped well is radiating
outward in the form of circular film
on the surface of the water. If the
radius of a circle is increasing at
the rate of 10 meters per minute,
how fast is the area of the oil film
growing in square meters per
minute at the instant when the
radius is 22 meters?
Answer:
Step-by-step explanation:
Area of the circle = 1400π
ie. πr^2 = 1400π . ie r^2 =1400. So r=10√14
Area A = πr^2.Differentiate w.r.t.t
dA/dt = 2πr. dr/dt
900 = 2×π×10√14 .dr/dt
So. dr/dt = 900/2×π×10√14 = 45/π√14 m/sec.
Hope this answer helps you :)
Have a great day
Mark brainliest
evaluate this expression 5+3(8-2)
Answer:86 Step-by-step explanation:
HELPP HELPPP ????pls
Answer:
B) the interquartile range of the data set is 2
Step-by-step explanation:
To find the interquartile range you have to subtract Q3-Q1. Which would be 3-1 and the answer is 2.
Hope this helped :)
Kirk ran 7 1/2 miles around the track. Each lap is 2 1/2 miles. How many laps did Kirk run?
Write your answer as a fraction or as a whole or mixed number.
Josh says that -5/4 has the same quotient as 5/-4 Is this true or false?
True
False
Following are the introduced the accompanying observations on bond strength.
11.5 12.1 9.9 9.3 7.8 6.2 6.6 7.0 13.4 17.1 9.3 5.6 5.7 5.4 5.2 5.1 4.9 10.7
15.2 8.5 4.2 4.0 3.9 3.8 3.6 3.4 20.6 25.5 13.8 12.6 13.1 8.9 8.2 10.7 14.2
7.6 5.2 5.5 5.1 5.0 5.2 4.8 4.1 3.8 3.7 3.6 3.6 3.6
Required:
Estimate true average bond strength in a way that conveys information about precision and reliability.
Answer:
Average strength of bond = 8.08 (Approx.)
Step-by-step explanation:
Given data;
11.5 12.1 9.9 9.3 7.8 6.2 6.6 7.0 13.4 17.1 9.3 5.6 5.7 5.4 5.2 5.1 4.9 10.7 15.2 8.5 4.2 4.0 3.9 3.8 3.6 3.4 20.6 25.5 13.8 12.6 13.1 8.9 8.2 10.7 14.2 7.6 5.2 5.5 5.1 5.0 5.2 4.8 4.1 3.8 3.7 3.6 3.6 3.6
Find:
Average strength of bond
Computation:
Average mean = Sum of all observation / Number of observation
Average strength of bond = [11.5 + 12.1 + 9.9 + 9.3 + 7.8 + 6.2 + 6.6 + 7.0 + 13.4 + 17.1 + 9.3 + 5.6 + 5.7 + 5.4 + 5.2 + 5.1 + 4.9 + 10.7 + 15.2 + 8.5 + 4.2 + 4.0 + 3.9 + 3.8 + 3.6 + 3.4 + 20.6 + 25.5 + 13.8 + 12.6 + 13.1 + 8.9 + 8.2 + 10.7 + 14.2 + 7.6 + 5.2 + 5.5 + 5.1 + 5.0 + 5.2 + 4.8 + 4.1 + 3.8 + 3.7 + 3.6 + 3.6 + 3.6] / 48
Average strength of bond = [387.8] / 48
Average strength of bond = 8.0791
Average strength of bond = 8.08 (Approx.)
Consider the following statements about the effect of different values of a on the function y = ab^x. Which one of the statements, if any, is incorrect?
A. Values of a such that |a| > 1 will vertically stretch the graph of y = b^x.
B. Values of a such that 0 < |a| < 1 will vertically compress the graph of y = b^x.
C. Negative values of a will reflect y = b^x across the y-axis.
D. All of the above statements are correct.
No, There is no any sentences are incorrect.
Hence, All sentences are correct.
What is mean by Function?A relation between a set of inputs having one output each is called a function. and an expression, rule, or law that defines a relationship between one variable (the independent variable) and another variable (the dependent variable).
Given that;
Consider the following statements about the effect of different values of a on the function,
⇒ y = a bˣ
Now, We know that;
For the value of a such that |a| > 1
The graph of y = bˣ is vertically stretch.
And, For the values of a such that 0 < |a| < 1;
The graph of y = bˣ is vertically compress.
And, When we take negative value of a.
Then, Function reflect y = bˣ across the y-axis.
Thus, There is no any sentences are incorrect.
Hence, All sentences are correct.
Learn more about the function visit:
https://brainly.com/question/11624077
#SPJ3