<7 and <8 are vertical angles can you shoe me how to draw this please

Answers

Answer 1

Vertical angles are opposite of each othe. Attached is a picture of how it looks:

I hope this helps!

&lt;7 And &lt;8 Are Vertical Angles Can You Shoe Me How To Draw This Please

Related Questions

Diana is packing a lunch that will include an orange. Diana has 3 navel oranges, 5 mandarin oranges, and 4 Valencia oranges. If Diana selects an orange at random, what is the probability that she selects a navel orange?

Give your answer as a simplified fraction.

Answers

Answer:

Step-by-step explanation:

1. Ok. Probability is something out of all. Add to get the bottom base of the probability.

3+4+5= 12

2. Probability is something out of something so 3 navel oranges can be represented out of 12 oranges.

3 out of 12

3. Make as fraction:

3 out of 12=

3/12=

1/4 or 25 Percent!

Answer: 1/4 or 25% ( If wanted as Percent)

Answer:

1/4

Step-by-step explanation:

Number of navel oranges = 3.

Number of mandarin oranges = 5.

Number of Valencia oranges = 4.

Let N be an event that Diana selects navel orange.

The total number of oranges Diana has:

n(T)=3+5+4=12n(T)=3+5+4=12

Number of navel Oranges is:

n(N)=3n(N)=3

The probability that Diana selects a navel orange is:

P(N)=n(N)n(T)=312=14P(N)=n(N)n(T)=312=14

Hence, the probability that Diana selects a navel orange is 1414.

a certain species of bird migrates 10,000 miles in 75 days a person race walking can walk 20 kilometers in 100 minutes

who goes faster

Answers

A person race walking a distance of 20 kilometers in 100 minutes is more faster with a speed of 0.2 kilometer per minutes.

How to determine who is faster?

Mathematically, the speed of a physical object or body can be calculated by using this formula;

Speed = distance/time

Next, we would convert the unit of distance covered by the bird in miles to kilometers as follows:

1 mile = 1.60934 kilometer.

10,000 miles = X kilometer.

Cross-multiplying, we have:

X kilometer = 10,000 miles × 1.60934 kilometer.

X kilometer = 16,093.4 kilometer.

Also, we would convert the unit of time in days to minutes as follows:

1 day = 1,440 minutes

75 days = X minutes

Cross-multiplying, we have:

X minutes = 75 days × 1,440

X minutes = 108,000 minutes.

Now, we can calculate the speed of this bird as follows:

Speed = 16,093.4/108,000

Speed = 0.1490 kilometer per minutes.

For the speed of the person, we have:

Speed = 20/100

Speed = 0.2 kilometer per minutes.

Read more on speed here: brainly.com/question/8163450

#SPJ1

Please help with the following question.

Answers

Answer:

Step-by-step explanation:

C

the difference between two numbers is 547. one is 268 find the larger​

Answers

Answer:

279

Step-by-step explanation:

How many different​ 10-letter words​ (real or​ imaginary) can be formed from the following​ letters? cbqgvlbbgc

Answers

Using mathematical permutation, there 30240 number of 10-letter words that can be formed from the arrangement of letters cbqgvlbbgc

What is permutation?

Permutation is simply the manner of arrangement or selection of elements.

We shall calculate for the permutation of the letters cbqgvlbbgc as follows:

There are total of 10 letters

c = 2

b = 3

g = 2

q = 1

v = 1 and,

l = 1

permutation of cbqgvlbbgc = 10!/(2! × 2! × 3!)

permutation of cbqgvlbbgc = (10 × 9 × 8 × 7 × 6 × 5 × 4 × 3!)/(2! × 2! × 3!)

dividing common factors of the numerator and denominator, we have

permutation of cbqgvlbbgc = 10 × 9 × 8 × 7 × 6 × 5

permutation of cbqgvlbbgc = 30240

Therefore by permutation, we derived 30240ways 10-letter words can be arranged from the letters cbqgvlbbgc.

Know more about permutation here: https://brainly.com/question/12468032

#SPJ1

what is the domain and range of
{(3,2).(6,5),(9,9)}

Answers

Check the picture below.

A basic cellular package costs $40 /month for 60 minutes of calling with an additional charge of $0.20 /minute beyond that time. The cost function C(x) for using x minutes would be

If you used 60 minutes or less, i.e. if if x≤60 , then C(x)=40 (the base charge).
If you used more than 60 minutes, i.e. (x−60) minutes more than the plan came with, you would pay an additional $0.20 for each of those (x−60) minutes. Your total bill would be C(x)=40+0.20(x−60) .


If you want to keep your bill at $50 or lower for the month, what is the maximum number of calling minutes you can use?

Answers

Answer:

78

exclamation is that if 50 is lower than 60 which it is meaning that 78 is the correct answer if you multiply 18 + 34 that is not the right answer but there should be a right answer under this question you shouldn't trust me because I do not give a what the answer is I do not suggest you write down this answer but you do your top G

The maximum number of calling minutes you can use to keep your bill at $50 or lower is 110 minutes. If you use 110 minutes or less, your bill will not exceed $50.

To keep your bill at $50 or lower for the month, you need to set up an inequality using the cost function C(x):

C(x) = 40 + 0.20(x - 60)

Since you want to keep the cost at or below $50, the inequality is:

C(x) ≤ 50

Now, substitute the expression for C(x) into the inequality:

40 + 0.20(x - 60) ≤ 50

40 + 0.20x - 12 ≤ 50

0.20x + 28 ≤ 50

Now, isolate the term with "x" on one side by subtracting 28 from both sides:

0.20x ≤ 50 - 28

0.20x ≤ 22

Finally, divide both sides by 0.20 to solve for "x":

x ≤ 22 / 0.20

x ≤ 110

The maximum number of calling minutes you can use to keep your bill at $50 or lower is 110 minutes. If you use 110 minutes or less, your bill will not exceed $50.

Learn more about maxima here:

https://brainly.com/question/12870695?

#SPJ2

3. Cameron has been given 4 boxes with samples
of soil. If all of the samples can either be
classified as mineral-rich, mineral-neutral, or
mineral-poor, how many different ways could
Cameron possibly classify all 4 samples, given
that they could all be classified as the same type
if that were the case?
A. 3
B. 4
C. 12
D. 81

Answers

Answer: D. 81

Step-by-step explanation:

Box A: 3 possibilites

Box B: 3 possibilites

And so on, so you get 3^4, which is 81

10x+2y=41
Solve for y and x

Answers

Answer:

{x,y}={25/7,41/7}

Step-by-step explanation:

During the time Tommy eat two bowls of ice cream, Robert eats three bowls of ice cream. The two boys ten bowls of ice cream in one hour. How many bowls did Tommy eat? Show working

Answers

Answer:20

Step-by-step explanation:

If h = 7 find value of h2

Answers

h(2)
If h = 7, then:
7(2)
= 14

Given f(x) = x³ + kx + 3, and x + 3 is a factor of f(x), then what is the value of
k?

Answers

If (x + 3) is a factor of f(x) = x³ + kx + 3 , then the value of k is -8 .

In the question ,

it is given that ,

the function is f(x) = x³ + kx + 3 ,

and also given that (x+3) is a factor of f(x) , that means

x + 3 = 0

x = -3

x = -3 should satisfy the function ,

So , substituting x = -3 in the function f(x) = x³ + kx + 3,

we get

f(-3) = (-3)³ + k(-3) + 3 = 0

-27 -3k + 3 = 0

-3k - 24 = 0

-3k = 24

k = 24/(-3)

k = -8

Therefore , If (x + 3) is a factor of f(x) = x³ + kx + 3 , then the value of k is -8 .

Learn more about Factors here

https://brainly.com/question/19438583

#SPJ1

Explain what the vertical line test is and how it is used

Answers

Answer:

You take a pencil and slowly go across the graph from left to right.  If any two points are under the pencil at any one time, the relations is not a function.  For a relations to be a function, every input must have only one output, so there will be no two points graphed vertically on top of each other.

Step-by-step explanation:

Which is equivalent to 644 ?

Answers

6442
O 244
O 4
O 16
O 164/4

can someone pls help me

Answers

Answer: AAS

Step-by-step explanation:

Because of the pair of vertical angles, there are two pairs of congruent angles and one pair of congruent sides. This means the triangles are congruent by AAS.

HElp using trigonometry how do I solve this?

Answers

By using trignometry we got the side p as 6.67

Use the cosine rule of trignometry to find side p

p² = r² + q² - 2rqcosP

To find the angle of p we will simply subtract angle R and angle Q from 180.

180 - 47.28 - 40 = 92.72

p² = 8² + 7² + 2(8)(7)cos(92.72)

p² = 107.685

p = √107.685

p = 10.38

Let's suppose that the shortest distance of R from PQ is .

look at the diagram I gave

since the line I made makes a right angled triangle, we can use SOH CAH TOA

for the angle 40,  is opposite and 10.38 is hypotenuse

which means we will have to use SOH

sin40 = O/H

sin40 =x /10.38

0.6428 = x/10.38

0.6428 × 10.38 = x

x = 6.67

Hence, by using trignometry we got the side p as 6.67

To learn more about heights and distance refer here

https://brainly.com/question/25748640

#SPJ1

Disclaimer,

The given question is incomplete, the answer is done based upon a similar question. The question is given in the image attached.

Michael is working two summer jobs, making $19 per hour lifeguarding and making
$14 per hour clearing tables. In a given week, he can work at most 17 total hours and
must earn a minimum of $280. If a represents the number of hours lifeguarding and
y represents the number of hours clearing tables, write and solve a system of
inequalities graphically and determine one possible solution.

Answers

The possible solutions are 8 hours and 9 hours.

The number of hours for lifeguarding is 8 hours.

The number of hours for clearing tables is 9 hours.

What is inequality?

It shows a relationship between two numbers or two expressions.

There are commonly used four inequalities:

Less than = <

Greater than = >

Less than and equal = ≤

Greater than and equal = ≥

We have,

Two summer jobs:

Lifeguarding.

x = number of hours

= $19 per hour

Cleaning tables.

y = number of hours

=$14 per hour

Total hours in a week = 17 hours

Minimum earning = $280

The inequality represents the above situation.

x + y ≥ 17

19x + 14y ≥ 280

Solving for x and y.

x + y = 17 _____(1)

x = 17 - y

19x + 14y = 280 ______(2)

Putting (1) in (2) we get,

19(17 - y) + 14y = 280

323 - 19y + 14y = 280

323 - 5y = 280

323 - 280 = 5y

43 = 5y

y = 43/5

y = 8.6

y = 9

Now,

x = 17 - y

x = 17 - 8.6

x = 8.4

x = 8

Thus,

The possible solutions are 8 hours and 9 hours.

The number of hours for lifeguarding is 8 hours.

The number of hours for clearing tables is 9 hours.

Learn more about inequalities here:

https://brainly.com/question/20383699

#SPJ1

4x^{2}+16y^{2}-24x+64y+36=0
The center is:
The vertices are:
The foci are:

Answers

For the given equation,4x²−y²−24x−4y+28=0.The center is (h,k)=(3,−2), vertex (h+a,k)=(4,−2) and (h−a,k)=(2,−2), foci is (h+c,k)=(5.23,−2) and (h−c,k)=(0.77,−2)

What is the equation?

An equation is a statement that two expressions, which include variables and/or numbers, are equal. In essence, equations are questions, and efforts to systematically find solutions to these questions have been the driving forces behind the creation of mathematics.

It is given that, the equation of the hyperbola is,

4x²−y²−24x−4y+28=0

Comparing the equation with the standard equation we get,

Center (h,k)=(3,−2)

Vertex (h+a,k)=(4,−2) and (h−a,k)=(2,−2)

Foci (h+c,k)=(5.23,−2) and (h−c,k)=(0.77,−2)

Asymptotes y=2x−8 and y=−2x+4

Thus, for the given equation,4x²−y²−24x−4y+28=0.The center is (h,k)=(3,−2), vertex (h+a,k)=(4,−2) and (h−a,k)=(2,−2), foci is (h+c,k)=(5.23,−2) and (h−c,k)=(0.77,−2)

Learn more about the equation here,

https://brainly.com/question/10413253

#SPJ2

How many times did the team score less than 60 points?
Stem
4
5
6
7
Leaf
2,5,9
3,4,6,8,8,9
0,2,3,4,4,6,8
0,0,1,2

Answers

The team scored less than 60 nine time. This can be determined simply by counting the number of leaves next to 4 and 5 because they represent numbers in the 40s and 50s

Which of the given formulas for the general term of the sequence 8, 5, 2, –1, –4, ...

is correct?
a. tn = −3n + 11
b. tn = 3n + 11
c. tn = 3n + 8
d. tn = 3n − 8

Answers

The term is tn=-3n+11

From the question, we have

The sequence is 8, 5, 2, –1, –4, ...

d = 5-8 = -3

t1 = 8

tn = t1+(n-1)d

tn=8+(n-1)(-3)

tn=8-3n+3

tn=-3n+11

Addition:

The phrase "the addition" refers to combining two or more numbers. Adding two numbers is indicated by the plus sign (+), therefore adding three is written as three plus three. Additionally, the number of times the plus symbol (+) is used is up to you. For example, 3 + 3 + 3 + 3. Mathematical addition is a crucial component of the learning curriculum for kids. In primary school, students learn simple addition sums such as one-digit facts,

Math addition sums, and double-digit Math addition sums. One of the most fundamental and interesting

Math concepts for elementary school children is addition sums. Math is a fascinating subject, and children first learn basic mathematical concepts like adding numbers in their early years.

To learn more about addition visit: https://brainly.com/question/680614

#SPJ1

Step A

Let x = Elijah’s age.


x + 4 = James’s age


2(x +4) = Bryan’s age.




Step B

x + x + 4 + 2(x +4) = 80.


Step C 4x + 12 = 80

X = 17


Step D James is 21.



1. Above is a solution to a verbal problem on the Algebra 1 test. Write the word problem that the student was solving.

2. If the equation in step B had been 2(x + 4) = 80, would the wording of the word problem change or stay the same? If it changed, what would it say now?

Answers

1.  Elijah is the smallest sibling among his brother who is 4 years older than her and Bryan is the eldest sibling who is twice as James, what is his age of James if the sum of their ages is 80 years?

2. If the equation in step B had been 2(x + 4) = 80,  the changed statement would be Bryan is 80 years old.

What is a numerical expression?

A numerical expression is a mathematical statement written in the form of numbers and unknown variables. We can form numerical expressions from statements.

Here we are converting a numerical expression into a statement.

Given,

Step A

Let x = Elijah’s age.

x + 4 = James’s age

2(x +4) = Bryan’s age.

Step B

x + x + 4 + 2(x +4) = 80.

Step C 4x + 12 = 80

X = 17

Step D James is 21.

The verbal problem to the algebra test can be stated as

Elijah is the smallest sibling among his brother who is 4 years older than her and Bryan is the eldest sibling who is twice as James, what is the age of James if the sum of their ages is 80 years?

If the equation in step B had been 2(x + 4) = 80,  the changed statement would be Bryan is 80 years old.

learn more about numerical expressions here :

https://brainly.com/question/29199574

#SPJ1


The bookshop received a shipment of identification books. 1/3 of them were bird books, 1/2 of the rest of the books
were about plants, and 1/4 of the remaining books were mammal books. The 12 books that were left were insect
books. How many books were in the shipment?

Answers

Answer:

48

Step-by-step explanation:

1/3+(1/2*2/3)+(1/4*1/3)=3/4

1-3/4=1/4

So 12 book were 1/4 of the shipment.

So 48 book sis total.

Find the equation (in slope-intercept form) of the line

slope: 85, ordered pair: (0,−43)

Answers

The equation in slope-intercept form is y = 85x - 43

How to determine the equation of the line?

The given parameters are

Ordered pair, (x, y)= (0, -43)Slope, m = 85

A linear equation is represented as

y = m(x - X) + Y

Where m is the slope

Substitute the known values in the above equation

So, we have the following equation

y = 85(x - 0) - 43

Evaluate

y = 85x - 43

Hence. the linear equation is y = 85x - 43

Read more about linear equation at

brainly.com/question/14323743

#SPJ1

The lifeguards on a beach in Hawaii found a correlation between the height of a wave (y) and the number of surfers on the beach (x). The equation they calculated was y = 0.95x + 20. If the wave height was 4 feet, about how many surfers would be on the beach?

Answers

Answer:

Step-by-step explanation:

hope this helps

The length of the rectangular lot is 25 ft longer than twice the width. If the perimeter of the lot cannot exceed 350 ft, what is the greatest width possible?

Answers

The greatest width possible if the length of the rectangular lot is 25 ft longer than twice the width and if the perimeter of the lot cannot exceed 350 ft is 50 ft.

We are given,

The length of the rectangular lot is 25 ft longer than twice the width.

The perimeter of the lot cannot exceed 350 ft.

Let the width of the rectangular lot be x.

So, the length of the rectangular lot =  2x + 25

We know that the perimeter of the rectangle is given by:

P = 2(L + W)

Substitute the given values in the above formula;

350 = 2(2x +25 + x)

350 / 2 = 3x + 25

175 - 25 = 3x

x = 150 / 3

x = 50 ft

So, the width of the rectangular lot = 50 ft

And, the length of the rectangular lot = 2 * 50 + 25 = 125

Thus, the greatest width possible if the length of the rectangular lot is 25 ft longer than twice the width and if the perimeter of the lot cannot exceed 350 ft is 50 ft.

To learn more about rectangle visit:

https://brainly.com/question/27722891

#SPJ1

A truck travels 50 m/s in a 30 second time frame what is the average speed

Answers

The average speed of the truck is 50 m/s .

We know that the average speed of any vehicle is calculated by total distance divide by total time.

Now the truck travels at 50 m/s for 30 seconds.

Distance covered in 30 seconds = 50 × 30 = 1500 meters

Time taken = 30 seconds

average speed = 1500 / 30 = 50 m/s

The average speed now accounts for the majority of the distance travelled. Average speed is essentially a method for calculating distance and the rate of transit time.

Knowing the average speed is crucial because it is clear that the pace will vary throughout the voyage. The average speed of a vehicle or an object can be determined using a variety of methods.

That is the most popular and simple way for figuring your average speed. It functions best when the object's speed remains constant throughout the journey, never rising or falling.

To learn more about average speed visit:

brainly.com/question/4657663

#SPJ1

HI i need this questions answer as soon as possible WITH STEPS PLEASE

Answers

Answer:

210

Step-by-step explanation:

200 × (5% + 1)

=200 × (0.05 + 1)

=200 × 1.05

=210

yan po hope it helps

A small theatre's profit, P(x), from selling concert tickets is P(x) = −15x2 + 60x + 30, where x is the number of $2 price increases of each ticket. Use the graph below to answer the question.

Graph of function p of x equals negative 15 x squared plus 60 x plus 30. The graph has the x-axis labeled as number of price increases, and the y-axis labeled as profit. The curve begins at (0, 30) and increases to (2, 90) and then decreases through (4.449, 0).

How many price increases maximized the theatre's profit?

0
1.5
2
4.5

Answers

Using the vertex of the quadratic equation, it is found that the profit will be maximized when each ticket price is sold for $2.

What is the vertex of a quadratic equation?

A quadratic equation is the second-order degree algebraic expression in a variable. the standard form of this expression is  ax² + bx + c = 0 where a. b are coefficients and x is the variable and c is a constant.

Considering the coefficient a, we have;

If a < 0, the vertex is a maximum point.

If a > 0, the vertex is a minimum point.

In this question, the function is modeled as follows, considering x as the price divided by $2.

P(x) = -15x² + 60x + 30.

The coefficients are a = -15 < 0, b = 60, c = 30, therefore the x-value of the vertex is given by:

V = -b/2a

V = -60/2(-15)

V = -60/-30

V = 2

Hence, the profit will be maximized when each ticket price is sold for $2.

More can be learned about the vertex of a quadratic equation at brainly.com/question/24737967

#SPJ1

Please I need help to doing this pleaseee help me

Answers

The equation of line in the given graph with coordinate points (2,-2) and (-3,-6) is 4x-5y=18.

What is equation of line?

A straight line's general equation is y = mx + c, where m is the gradient and y = c is the value at which the line intersects the y-axis. This value c is known as the y-axis intercept. Linear equations are classified into three types: point-slope, standard, and slope-intercept. The equation of a two-dimensional line is ax+by=c; it is fair to predict that the equation of a three-dimensional line is ax+by+cz=d; reasonable, but incorrect—it turns out that this is the equation of a plane. A plane, unlike a line, does not have a clear "direction."

Here,

The coordinates of line will be (2,-2) and (-3,-6).

slope m=(-6-(-2))/(-3-2)

=-4/-5

=4/5

(y-y1)=m(x-x1)

y+2=4/5(x-2)

5(y+2)=4(x-2)

5y+10=4x-8

4x-5y=18

4x-5y=18 is the equation of the line in the given graph with coordinate points (2,-2) and (-3,-6).

To know more about equation,

https://brainly.com/question/10413253?referrer=searchResults

#SPJ1

I need an answer ASAP. A football player runs the ball from the 20-yard line on one side of the field to the 20-yard line on the other side. How many yards did the player run?? 100 pts and the brainliest.

Answers

The player ran 60 yards on the football field

How to find the distance covered by the player

A football field measures a length of 100 yards, using subtraction the required dimensions are calculated

The player started form 20 yards line to 20 yard of the other end of the field

The player did not ran the initial 20 yards and the finial 20 yards

this added to give 40 yards

Length covered by the player

100 yards - 40 yards =  60 yards

Learn more about football field here:

https://brainly.com/question/29399743

#SPJ1

Other Questions
2. explain how molecular exclusion chromatography can be used to measure the molecular mass of a protein. if you wish to make a zn/zn2 concentration cell, what should be the relationship between the ion concentrations? Solve for y:-3 + 18iy = x + 9iA) -3B) 0.5C) 2D) 4 all of the following would be considered manufacturing overhead costs by a book publisher except a. wages paid to the production supervisor. b. fire insurance on the printing facilities. c. depreciation on the printing equipment. d. rent on the warehouse containing the finished books inventory. Iran, iraq, kuwait, saudi arabia, and venezuela came together in 1960 to from what?. What is the central idea of the second paragraph? A. how King James upset the Catholics B. how Guy Fawkes' plan failed C. why Guy Fawkes' led the plot D. why children make the "Guy" dummies a voltmeter pointer is 6 centimeters in length (see figure). find the number of degrees through which it rotates when it moves 2.1 centimeters on the scale. (round your answer to two decimal places.) Work out M and C for the line:Y=2x+5M= C= Why does Eliot think of Shakespeare's Hamlet as a work that represents the efforts of several writers? (See paragraphs 3-4.) What statement about the graph is true? Tu jefe pide que abras la puerta, pero tienes muchas llaves true or false? a strategy used in the later stages of stage of change tailored counseling is to have him or her do a decisional balance exercise by weighing the pros and cons of exercising. erikson holds that adolescence provides a psychosocial moratorium, or "time out" period, which What is affordable care act? What is the solution to the health care issue in the US ? Identify the problems that exists & explain a possible solution. Pick ONE area to focus on: 1. The style of care: conventional health care and/or alternative health care Or 2. How health insurance costs are determined & who pays for them predict how the rate of cell division would differ between single-celled algae living in a sunny, nutrient-rich pond versus algae living in a shady, nutrient-poor pond. explain why. how could you test your prediction? (hint: think about what stages of the cell cycle are cells when they are actively dividing robert is a black box penetration tester who conducted pen testing attacks on all of the network's application servers. he was able to exploit a vulnerability and gain access to the system. which task should he perform next? Why is taq dna polymerase used in pcr reactions rather than a normal dna polymerase?. Select the true statement about the following linear equation. y= -2x + 4 The graph is a curve The y-intercept is -2 The slope is -2 The slope is 2 an anhydrous (water removed) salt has a formula mass of 130.863 g/mol. if the hydrated version of the salt has 3 mol of water associated with it, what is the mass % of water in the hydrated salt? report your answer to three digits after the decimal.