Model−−−−−: P=2,320(1.2)x

The model is used to estimate the deer population in a region, where x is the number of years after the year 2009. Using the model, estimate the deer population in the year 2018

Answers

Answer 1

The population of the deer in year 2018 would be 11971.

Given,

In the question:

The model is used to estimate the deer population in a region, where x is the number of years after the year 2009. Using the model, estimate the deer population in the year 2018

Model is given as:

P = 2,3201 [tex](1.2)^x[/tex]

Now, According to the question:

The number of years from 2009 to 2018 = 9

Here, the equation that shows the deer population after x years since 2009,

P = 2,3201 [tex](1.2)^x[/tex]

Substitute x=9 in the above equation,

P = 2,3201[tex](1.2)^9[/tex]

P = 2320(5.15978)

P ≈ 11971

Hence,  the population of the deer in year 2018 would be 11971.

Learn more about Estimation at:

https://brainly.com/question/27839637

#SPJ9


Related Questions

pls help ill give brainliest

Answers

Answer:

(- 12, 10 )

Step-by-step explanation:

2x + 4y = 16 → (1)

- 2x - 3y = - 6 → (2)

add (1) and (2) term by term to eliminate x

0 + y = 10

y = 10

substitute y = 10 into (1) and solve for x

2x + 4(10) = 16

2x + 40 = 16 ( subtract 40 from both sides )

2x = - 24 ( divide both sides by 2 )

x = - 12

solution is (- 12, 10 )

Answer:

(- 12, 10 )

Step-by-step explanation:

mark the person above me as brainliest

Please I need help to doing this pleaseee help me

Answers

The equation of line in the given graph with coordinate points (2,-2) and (-3,-6) is 4x-5y=18.

What is equation of line?

A straight line's general equation is y = mx + c, where m is the gradient and y = c is the value at which the line intersects the y-axis. This value c is known as the y-axis intercept. Linear equations are classified into three types: point-slope, standard, and slope-intercept. The equation of a two-dimensional line is ax+by=c; it is fair to predict that the equation of a three-dimensional line is ax+by+cz=d; reasonable, but incorrect—it turns out that this is the equation of a plane. A plane, unlike a line, does not have a clear "direction."

Here,

The coordinates of line will be (2,-2) and (-3,-6).

slope m=(-6-(-2))/(-3-2)

=-4/-5

=4/5

(y-y1)=m(x-x1)

y+2=4/5(x-2)

5(y+2)=4(x-2)

5y+10=4x-8

4x-5y=18

4x-5y=18 is the equation of the line in the given graph with coordinate points (2,-2) and (-3,-6).

To know more about equation,

https://brainly.com/question/10413253?referrer=searchResults

#SPJ1

HElp using trigonometry how do I solve this?

Answers

By using trignometry we got the side p as 6.67

Use the cosine rule of trignometry to find side p

p² = r² + q² - 2rqcosP

To find the angle of p we will simply subtract angle R and angle Q from 180.

180 - 47.28 - 40 = 92.72

p² = 8² + 7² + 2(8)(7)cos(92.72)

p² = 107.685

p = √107.685

p = 10.38

Let's suppose that the shortest distance of R from PQ is .

look at the diagram I gave

since the line I made makes a right angled triangle, we can use SOH CAH TOA

for the angle 40,  is opposite and 10.38 is hypotenuse

which means we will have to use SOH

sin40 = O/H

sin40 =x /10.38

0.6428 = x/10.38

0.6428 × 10.38 = x

x = 6.67

Hence, by using trignometry we got the side p as 6.67

To learn more about heights and distance refer here

https://brainly.com/question/25748640

#SPJ1

Disclaimer,

The given question is incomplete, the answer is done based upon a similar question. The question is given in the image attached.

4x^{2}+16y^{2}-24x+64y+36=0
The center is:
The vertices are:
The foci are:

Answers

For the given equation,4x²−y²−24x−4y+28=0.The center is (h,k)=(3,−2), vertex (h+a,k)=(4,−2) and (h−a,k)=(2,−2), foci is (h+c,k)=(5.23,−2) and (h−c,k)=(0.77,−2)

What is the equation?

An equation is a statement that two expressions, which include variables and/or numbers, are equal. In essence, equations are questions, and efforts to systematically find solutions to these questions have been the driving forces behind the creation of mathematics.

It is given that, the equation of the hyperbola is,

4x²−y²−24x−4y+28=0

Comparing the equation with the standard equation we get,

Center (h,k)=(3,−2)

Vertex (h+a,k)=(4,−2) and (h−a,k)=(2,−2)

Foci (h+c,k)=(5.23,−2) and (h−c,k)=(0.77,−2)

Asymptotes y=2x−8 and y=−2x+4

Thus, for the given equation,4x²−y²−24x−4y+28=0.The center is (h,k)=(3,−2), vertex (h+a,k)=(4,−2) and (h−a,k)=(2,−2), foci is (h+c,k)=(5.23,−2) and (h−c,k)=(0.77,−2)

Learn more about the equation here,

https://brainly.com/question/10413253

#SPJ2

what is the domain and range of
{(3,2).(6,5),(9,9)}

Answers

Check the picture below.

How many different​ 10-letter words​ (real or​ imaginary) can be formed from the following​ letters? cbqgvlbbgc

Answers

Using mathematical permutation, there 30240 number of 10-letter words that can be formed from the arrangement of letters cbqgvlbbgc

What is permutation?

Permutation is simply the manner of arrangement or selection of elements.

We shall calculate for the permutation of the letters cbqgvlbbgc as follows:

There are total of 10 letters

c = 2

b = 3

g = 2

q = 1

v = 1 and,

l = 1

permutation of cbqgvlbbgc = 10!/(2! × 2! × 3!)

permutation of cbqgvlbbgc = (10 × 9 × 8 × 7 × 6 × 5 × 4 × 3!)/(2! × 2! × 3!)

dividing common factors of the numerator and denominator, we have

permutation of cbqgvlbbgc = 10 × 9 × 8 × 7 × 6 × 5

permutation of cbqgvlbbgc = 30240

Therefore by permutation, we derived 30240ways 10-letter words can be arranged from the letters cbqgvlbbgc.

Know more about permutation here: https://brainly.com/question/12468032

#SPJ1

I really need help on this one I am confused and if someone could explain that would be great. also I am sorry the picture is flipped I couldn't turn it.

Answers

The hourly rate that the business owner should pay the employees to obtain the desired net income of $40,000 is of:

$17.

How to calculate the net income?

The net income is calculated as the subtraction of the total income by the expenses.

In the context of this problem, the expenses are given as follows:

Building and equipment: $900 a month = $10800 a year.Hearse: $200 per month = $2400 per year.Lead car: $150 per month = $1800 per year.Insurance: $1500 per year.Licensing/Certification: $250.Three employees, each working 20 hours a week = 52 x 20 = 1040 hours a year.

Hence the expression for the net income is given as follows:

110000 - [10800 + 2400 + 1800 + 1500 + 250 + 3(1040x)] = 40000

93250 - 3120x = 40000

3120x = 53250

x = 53250/3120

x = $17 an hour.

More can be learned about net income at https://brainly.com/question/25895372

#SPJ1

Which of the given formulas for the general term of the sequence 8, 5, 2, –1, –4, ...

is correct?
a. tn = −3n + 11
b. tn = 3n + 11
c. tn = 3n + 8
d. tn = 3n − 8

Answers

The term is tn=-3n+11

From the question, we have

The sequence is 8, 5, 2, –1, –4, ...

d = 5-8 = -3

t1 = 8

tn = t1+(n-1)d

tn=8+(n-1)(-3)

tn=8-3n+3

tn=-3n+11

Addition:

The phrase "the addition" refers to combining two or more numbers. Adding two numbers is indicated by the plus sign (+), therefore adding three is written as three plus three. Additionally, the number of times the plus symbol (+) is used is up to you. For example, 3 + 3 + 3 + 3. Mathematical addition is a crucial component of the learning curriculum for kids. In primary school, students learn simple addition sums such as one-digit facts,

Math addition sums, and double-digit Math addition sums. One of the most fundamental and interesting

Math concepts for elementary school children is addition sums. Math is a fascinating subject, and children first learn basic mathematical concepts like adding numbers in their early years.

To learn more about addition visit: https://brainly.com/question/680614

#SPJ1

3. Cameron has been given 4 boxes with samples
of soil. If all of the samples can either be
classified as mineral-rich, mineral-neutral, or
mineral-poor, how many different ways could
Cameron possibly classify all 4 samples, given
that they could all be classified as the same type
if that were the case?
A. 3
B. 4
C. 12
D. 81

Answers

Answer: D. 81

Step-by-step explanation:

Box A: 3 possibilites

Box B: 3 possibilites

And so on, so you get 3^4, which is 81

3(20/3)/2-5 Como se resuelve este??? Ayuda

Answers

I don’t speak spanish, but the answer is 5.

Michael is working two summer jobs, making $19 per hour lifeguarding and making
$14 per hour clearing tables. In a given week, he can work at most 17 total hours and
must earn a minimum of $280. If a represents the number of hours lifeguarding and
y represents the number of hours clearing tables, write and solve a system of
inequalities graphically and determine one possible solution.

Answers

The possible solutions are 8 hours and 9 hours.

The number of hours for lifeguarding is 8 hours.

The number of hours for clearing tables is 9 hours.

What is inequality?

It shows a relationship between two numbers or two expressions.

There are commonly used four inequalities:

Less than = <

Greater than = >

Less than and equal = ≤

Greater than and equal = ≥

We have,

Two summer jobs:

Lifeguarding.

x = number of hours

= $19 per hour

Cleaning tables.

y = number of hours

=$14 per hour

Total hours in a week = 17 hours

Minimum earning = $280

The inequality represents the above situation.

x + y ≥ 17

19x + 14y ≥ 280

Solving for x and y.

x + y = 17 _____(1)

x = 17 - y

19x + 14y = 280 ______(2)

Putting (1) in (2) we get,

19(17 - y) + 14y = 280

323 - 19y + 14y = 280

323 - 5y = 280

323 - 280 = 5y

43 = 5y

y = 43/5

y = 8.6

y = 9

Now,

x = 17 - y

x = 17 - 8.6

x = 8.4

x = 8

Thus,

The possible solutions are 8 hours and 9 hours.

The number of hours for lifeguarding is 8 hours.

The number of hours for clearing tables is 9 hours.

Learn more about inequalities here:

https://brainly.com/question/20383699

#SPJ1

the difference between two numbers is 547. one is 268 find the larger​

Answers

Answer:

279

Step-by-step explanation:

Which is equivalent to 644 ?

Answers

6442
O 244
O 4
O 16
O 164/4

ron picked 7/10 bushels of apples ben picked 9/10 bushels of apples how many apples did they pick all together give your answer in lowest terms

Answers

7/10+9/10=16/10=8/5bushels of apples

The lifeguards on a beach in Hawaii found a correlation between the height of a wave (y) and the number of surfers on the beach (x). The equation they calculated was y = 0.95x + 20. If the wave height was 4 feet, about how many surfers would be on the beach?

Answers

Answer:

Step-by-step explanation:

hope this helps

what is f(2) for f(x) = 3^x--13

Answers

f(2) = -4

Step-by-step explanation:

f(2) = 3^2-13

f(2) = 9-13

f(2) = -4

help with this equation ​

Answers

The equation of the line with coordinates (-7,3), (8,3) is y-3=0 as the slope of line is 0 because x-ordinate is same in both the points.

What is equation?

A straight line's general equation is y = mx + c, where m denotes the gradient and y = c denotes the point at which the line crosses the y-axis. On the y-axis, this value c is referred to as the intercept. The point-slope form, standard form, and slope-intercept form are the three main types of linear equations.

The two point form of equation,

y-y1=m(x-x1)

m=(y2-y1)/(x2-x1)

m=(3-3)/(8--7)

m=0

y-3=0(x+7)

y-3=0

Because the x-ordinate is the same at both points, the equation for the line with coordinates (-7,3) and (8,3) is y-3=0.

To know more about equation,

https://brainly.com/question/10413253?referrer=searchResults

#SPJ1

a certain species of bird migrates 10,000 miles in 75 days a person race walking can walk 20 kilometers in 100 minutes

who goes faster

Answers

A person race walking a distance of 20 kilometers in 100 minutes is more faster with a speed of 0.2 kilometer per minutes.

How to determine who is faster?

Mathematically, the speed of a physical object or body can be calculated by using this formula;

Speed = distance/time

Next, we would convert the unit of distance covered by the bird in miles to kilometers as follows:

1 mile = 1.60934 kilometer.

10,000 miles = X kilometer.

Cross-multiplying, we have:

X kilometer = 10,000 miles × 1.60934 kilometer.

X kilometer = 16,093.4 kilometer.

Also, we would convert the unit of time in days to minutes as follows:

1 day = 1,440 minutes

75 days = X minutes

Cross-multiplying, we have:

X minutes = 75 days × 1,440

X minutes = 108,000 minutes.

Now, we can calculate the speed of this bird as follows:

Speed = 16,093.4/108,000

Speed = 0.1490 kilometer per minutes.

For the speed of the person, we have:

Speed = 20/100

Speed = 0.2 kilometer per minutes.

Read more on speed here: brainly.com/question/8163450

#SPJ1

I need an answer ASAP. A football player runs the ball from the 20-yard line on one side of the field to the 20-yard line on the other side. How many yards did the player run?? 100 pts and the brainliest.

Answers

The player ran 60 yards on the football field

How to find the distance covered by the player

A football field measures a length of 100 yards, using subtraction the required dimensions are calculated

The player started form 20 yards line to 20 yard of the other end of the field

The player did not ran the initial 20 yards and the finial 20 yards

this added to give 40 yards

Length covered by the player

100 yards - 40 yards =  60 yards

Learn more about football field here:

https://brainly.com/question/29399743

#SPJ1

Explain what the vertical line test is and how it is used

Answers

Answer:

You take a pencil and slowly go across the graph from left to right.  If any two points are under the pencil at any one time, the relations is not a function.  For a relations to be a function, every input must have only one output, so there will be no two points graphed vertically on top of each other.

Step-by-step explanation:

can someone pls help me

Answers

Answer: AAS

Step-by-step explanation:

Because of the pair of vertical angles, there are two pairs of congruent angles and one pair of congruent sides. This means the triangles are congruent by AAS.

A basic cellular package costs $40 /month for 60 minutes of calling with an additional charge of $0.20 /minute beyond that time. The cost function C(x) for using x minutes would be

If you used 60 minutes or less, i.e. if if x≤60 , then C(x)=40 (the base charge).
If you used more than 60 minutes, i.e. (x−60) minutes more than the plan came with, you would pay an additional $0.20 for each of those (x−60) minutes. Your total bill would be C(x)=40+0.20(x−60) .


If you want to keep your bill at $50 or lower for the month, what is the maximum number of calling minutes you can use?

Answers

Answer:

78

exclamation is that if 50 is lower than 60 which it is meaning that 78 is the correct answer if you multiply 18 + 34 that is not the right answer but there should be a right answer under this question you shouldn't trust me because I do not give a what the answer is I do not suggest you write down this answer but you do your top G

The maximum number of calling minutes you can use to keep your bill at $50 or lower is 110 minutes. If you use 110 minutes or less, your bill will not exceed $50.

To keep your bill at $50 or lower for the month, you need to set up an inequality using the cost function C(x):

C(x) = 40 + 0.20(x - 60)

Since you want to keep the cost at or below $50, the inequality is:

C(x) ≤ 50

Now, substitute the expression for C(x) into the inequality:

40 + 0.20(x - 60) ≤ 50

40 + 0.20x - 12 ≤ 50

0.20x + 28 ≤ 50

Now, isolate the term with "x" on one side by subtracting 28 from both sides:

0.20x ≤ 50 - 28

0.20x ≤ 22

Finally, divide both sides by 0.20 to solve for "x":

x ≤ 22 / 0.20

x ≤ 110

The maximum number of calling minutes you can use to keep your bill at $50 or lower is 110 minutes. If you use 110 minutes or less, your bill will not exceed $50.

Learn more about maxima here:

https://brainly.com/question/12870695?

#SPJ2

tire could roll 200 yards in 27.28 revolutions , what is the radius of the tire?

Answers

The radius of the tire is 1.17 yards.

According to the question,

We have the following information:

A tire could roll 200 yards in 27.28 revolutions.

We know that the tire is in the shape of a circle.

We also that the following formula is used to find the circumference of the circle:

2πr where r is the radius of the circle

Now, we have the following expression:

2πr*27.28 = 200

54.56πr = 200

r = 200/54.56π

r = 200/54.56*3.14

r = 200/171.32

r = 1.17 yards

(The unit of the radius will remain same as that of the distance given.)

Hence, the radius of the tire is 1.17 yards.

To know more about radius of the tire here

https://brainly.com/question/13082921

#SPJ1

Find the equation (in slope-intercept form) of the line

slope: 85, ordered pair: (0,−43)

Answers

The equation in slope-intercept form is y = 85x - 43

How to determine the equation of the line?

The given parameters are

Ordered pair, (x, y)= (0, -43)Slope, m = 85

A linear equation is represented as

y = m(x - X) + Y

Where m is the slope

Substitute the known values in the above equation

So, we have the following equation

y = 85(x - 0) - 43

Evaluate

y = 85x - 43

Hence. the linear equation is y = 85x - 43

Read more about linear equation at

brainly.com/question/14323743

#SPJ1

Write an equation that has the given solutions. -4, 6​

Answers

Answer: Possible Answers:

x2+x−12=0

x2−x−12=0

x2+3x−4=0

2x2+2x−6=0

x2−4x−3=0

Step-by-step explanation: youer welcome

Diana is packing a lunch that will include an orange. Diana has 3 navel oranges, 5 mandarin oranges, and 4 Valencia oranges. If Diana selects an orange at random, what is the probability that she selects a navel orange?

Give your answer as a simplified fraction.

Answers

Answer:

Step-by-step explanation:

1. Ok. Probability is something out of all. Add to get the bottom base of the probability.

3+4+5= 12

2. Probability is something out of something so 3 navel oranges can be represented out of 12 oranges.

3 out of 12

3. Make as fraction:

3 out of 12=

3/12=

1/4 or 25 Percent!

Answer: 1/4 or 25% ( If wanted as Percent)

Answer:

1/4

Step-by-step explanation:

Number of navel oranges = 3.

Number of mandarin oranges = 5.

Number of Valencia oranges = 4.

Let N be an event that Diana selects navel orange.

The total number of oranges Diana has:

n(T)=3+5+4=12n(T)=3+5+4=12

Number of navel Oranges is:

n(N)=3n(N)=3

The probability that Diana selects a navel orange is:

P(N)=n(N)n(T)=312=14P(N)=n(N)n(T)=312=14

Hence, the probability that Diana selects a navel orange is 1414.

HI i need this questions answer as soon as possible WITH STEPS PLEASE

Answers

Answer:

210

Step-by-step explanation:

200 × (5% + 1)

=200 × (0.05 + 1)

=200 × 1.05

=210

yan po hope it helps

Given f(x) = x³ + kx + 3, and x + 3 is a factor of f(x), then what is the value of
k?

Answers

If (x + 3) is a factor of f(x) = x³ + kx + 3 , then the value of k is -8 .

In the question ,

it is given that ,

the function is f(x) = x³ + kx + 3 ,

and also given that (x+3) is a factor of f(x) , that means

x + 3 = 0

x = -3

x = -3 should satisfy the function ,

So , substituting x = -3 in the function f(x) = x³ + kx + 3,

we get

f(-3) = (-3)³ + k(-3) + 3 = 0

-27 -3k + 3 = 0

-3k - 24 = 0

-3k = 24

k = 24/(-3)

k = -8

Therefore , If (x + 3) is a factor of f(x) = x³ + kx + 3 , then the value of k is -8 .

Learn more about Factors here

https://brainly.com/question/19438583

#SPJ1

If h = 7 find value of h2

Answers

h(2)
If h = 7, then:
7(2)
= 14

How many times did the team score less than 60 points?
Stem
4
5
6
7
Leaf
2,5,9
3,4,6,8,8,9
0,2,3,4,4,6,8
0,0,1,2

Answers

The team scored less than 60 nine time. This can be determined simply by counting the number of leaves next to 4 and 5 because they represent numbers in the 40s and 50s
Other Questions
How many proper subsets does the set Z, Roman numerals, have? Z={ I, V, X, L, C, D, M, MD }. Which of these processes is required for a reaction but not for a reflex?motor neuron interneuronsensory receptorintegration in the cerebrum what is an example of meritocracy Which statement about the Chinese Exclusion Act is correct? a. The Act permitted the segregation of Chinese-American children into separate schools. b. The passage of the Act was motivated primarily by nativist sentiments. c. The Act limited Chinese immigration to states on the West Coast. d. Chinese-Americans were prohibited from practicing their religion by the Act. Read the thesis statement: If it weren't for Germany's treatment in the Treaty ofVersailles, World War II never would have happened.Which 2 of the following statements supports this thesis?The Great Depression would have weakened Germany whether they werepunished in the Treaty of Versailles or not.Germany's anger regarding several of the elements of the Treaty of Versaillescreated the German desire for revenge.The Treaty of Versailles led to economic hardship in Germany which allowed forthe rise of Hitler, who believed the Aryan race was destined to rule humanity.Hitler was determined to rise to power and would likely have done so with orwithout the harsh treatment Germans felt by the Treaty of Versailles.Germany was not the only country struggling after WWI, leading to the rise of afascist leader. your customer, shea, has a large portfolio of bonds and dividend paying stocks. her primary interest is generating current income. she is trying to understand how taxes work for her t-bonds. you explain that A friend has given you left-over landscaping bricks. You decide to make a garden bed and surround it with the bricks. There are 74 bricks, and each brick is 8 inches long. You would like the garden bed to be slightly more than twice as long as it is wide, as shown in the diagram below. You have also given yourself a budget of $150 for additional materials should you need them. Your local home improvement store sells the same bricks for $1.98 per brick. The displayed sides present the number of bricks on each side, where x is a number of bricks. low carbohydrate intake is a key feature of many fad diets. why do you think cutting down on carbohydrate consumption is such a popular weight loss strategy based on your understanding of this macronutrient? the solid oxide of generic metal m is added to 73 ml of water and reacts to produce a metal hydroxide solution that is 0.35 m in the resulting compound. the metal hydroxide solution then reacts with all of the 29 ml of 1.8 m hcl to form water and the metal salt. how many valence electrons must m have? which of the following explain the urban growth that occurred in the united states between 1820 and 1840? 15) two dimensions of emotional states determine if a shopper will react positively or negatively to a consumption environment. these two dimensions are best described as being . answer in one complete sentence using proper grammar and mechanics: what keeps a cruise ship that weighs over 50,000 tons from sinking in the ocean? what information is used by a process running on one host to identify a process running on another host? NO LINKS!! Use the diagram below to answer the following questions. Pro-forma FY+1 EPS for Amazon Inc. is expected to be: Review Later $45.71 $36.77 $50.00 $130.33 A farmer has 180 bushels of wheat to sell at her roadside stand.She sells an average of 14 5/8 bushels each day.Represent the total change in the number of bushels she has for sale after 5 days. Why is so difficult to pass laws in the United States? Which property is 1/4(24 x5) he black limo company (blc) purchased a limo on january 1 of year 1 at a cost of $48,000. the limo had a $8,000 salvage value. blc expected to drive the limo for 100,000 miles before disposing of it. actual miles driven per year were as follows: 30,000 in year 1, 40,000 in year 2, 20,000 in year 3, and 25,000 in year 4. based on this information, depreciation expense for year 4 was 10. Find point W on the y-axis so that VW + XW is a minimum given V(2, 3) andX(-2,-1).