The “rise” of the muffin is caused by the release of ___________ gas trapped in the mix as it is heated. carbon dioxide hydrogen oxygen helium

Answers

Answer 1

Answer:

Carbon dioxide

Explanation:

In the making of the muffins, there are many ingredients are used including flour, egg, butter, sugar, and flavoring of fruits. There is also a raising agent, the baking powder or baking soda used that reacts with the batter.

This reaction form bubbles of carbon dioxide, trapped in the air spaces during the baking and muffin raises. Carbon dioxide makes muffins light, by lifting the batter as it bakes.


Related Questions

carbon and tin are both in the fourth column of the table which would you expect to have the greater electronegativity

Answers

Answer: Carbon

Explanation:

electronegativity decreases when you go down a column

The study of chemical bonds is called chemistry.

The correct answer is carbon.

The more negative charge present on an atom shows the electronegativity.

The attraction of the nucleus to the proton is also referred to as electronegativity.

The smaller the radius more the electronegativity.

Hence, the correct answer is Carbon as it has fewer atoms and a smaller radius.

For more information, refer to the link:-

https://brainly.com/question/12985618

HELPP ME

express with equations the transformations marked on the scheme

Answers

Further explanation

The reaction equation is the chemical formula of reagents and product substances

A reaction coefficient is a number in the chemical formula of a substance involved in the reaction equation. The reaction coefficient is useful for equalizing reagents and products.

Transformations :

1. CaO + H₂O⇒Ca(OH)₂

2. CaO + CO₂⇒CaCO₃

3. Ca(OH)₂+ 2HCl⇒CaCl₂+2H₂O

4. Ca(OH)₂+H₂CO₃⇒CaCO₃+2H₂O

5. CaCO₃⇒CaO+CO₂

What is arcade in south Center

Answers

Answer: game stop and mind games

Explanation:

i live near there

What is the correct name for the following compound: P2Br5

Answers

Answer:

Diphosphorus pentabromide is the official name.

Explanation:

How many molecules of CO2 are contained in 4.40g of CO2

Answers

Answer:

6.02 x 10²²molecules

Explanation:

Given parameters:

Mass of CO₂  = 4.4g

Unknown:

Number of molecules in CO₂  = ?

Solution:

To find the number of molecules in the given mass, we have to find the number of moles in the compound first;

   Number of moles  = [tex]\frac{mass}{molar mass}[/tex]  

Molar mass of CO₂  = 12 + 2(16) = 44g/mol

Insert the parameters and solve;

   Number of moles  = [tex]\frac{4.4g}{44g/mol}[/tex]   =  0.1mol

  1 mole of a substance contains 6.02 x 10²³molecules

  0.1 mole of CO₂ will contain 0.1 x 6.02 x 10²³molecules

                                                 = 6.02 x 10²²molecules

For a certain chemical reaction, the bond energy of the reactants is 43 kJ, and 35 kJ of energy is released. For energy to be conserved, what is the bond energy of the products?

Answers

Answer:

78kJ

Explanation:

Energy change = Energy in (reactants) - Energy out (products)

According to this question, energy is released, meaning that the reaction is EXOTHERMIC. Hence, the energy change will be negative (-) i.e bond energy of reactants is greater than bond energy of products.

Energy in = bond energy of reactants = 43kJ

Energy out = bond energy of products = ?

Energy change of exothermic reaction = -35kJ

Therefore;

-35kJ = 43kJ - x

x = 35kJ + 43kJ

x = 78kJ

The bond energy of the products is 78kJ.

An oxide named CrO. So the salt of chromium has the corresponding valence​

Answers

Answer:

this question doesnt make any sene

Explanation:

What is the pressure inside a 2.0 L bottle filled with 0.25 mol of carbon dioxide gas at 25 °C?

Answers

Answer:

3.1atm

Explanation:

Given parameters:

Volume of gas = 2L

Number of moles  = 0.25mol

Temperature  = 25°C = 25 + 273  = 298K

Unknown:

Pressure of the gas = ?

Solution:

To solve this problem, we use the ideal gas equation.

This is given as;

       PV  = nRT

P is the pressure

V is the volume

n is the number of moles

R is the gas  constant  = 0.082atmdm³mol⁻¹K⁻¹

T is the temperature

          P  = [tex]\frac{nRT}{V}[/tex]  

 Now insert the parameters and solve;

         P  = [tex]\frac{0.25 x 0.082 x 298}{2}[/tex]   = 3.1atm

The average speeds of gas molecules in cylinders A, B, C, and D are 0.001 m/s, 0.05 m/s, 0.1 m/s, and 0.5 m/s respectively. Which cylinder contains gas that is closest to absolute zero?​

Answers

Answer:

cylindar a

Explanation:

I took the test

Answer:

A

Explanation:

Suggest a change of state, other than ice melting, that is an endothermic
process.​

Answers

Answer:

Vaporization and Sublimation

Explanation:

Answer:

Well there's solid states, liquid states, and gas states in matter.

the process that breaks down rocks

Answers

Weathering is the breaking down or dissolving of rocks and minerals on earths surface!

OK HURRY AND PLEASE ANSWER COZ THIS TEST IS TIMED BROS

What is the sum of the coefficients in the balanced chemical equation for the combustion of acetone, C3H6O(l), in air?
Express answer as an integer

Answers

Answer:

C3H6O + 4O2 → 3CO2 + 3H2O or 11

Explanation:

Answer:

11

Explanation:

Helpppppp!!!!! It’s due today
URGENT!!!!!

Answers

Answer:

Explanation:

2. a [CO3 2-][H3O+] / [H2O][HCO3-

b. [H2PO4-][H3O+]/[H3PO4][H2O]

Please help me with my Chemistry homework!! I have so much homework to do for other classes and I’m so stressed so even answering one question would be amazing!!!

1. A graduated cylinder had an initial volume of water of 22 mL. After an iron nail is dropped into the cylinder, the water rises to 38 mL. What is the volume of the nail?

2. Ms.Chavez dropped a gold ring into a graduated cylinder filled with water. The water level was originally at 20 mL. Now the water is at 25mL. Ms.Chavez knows that means the volume of the ring is 5 mL. What else would she have to do to find the density of her ring? Explain.

3. A simple of liquid propanol has a volume of 20.0 cm*^3 and a mass of 15.0 g. What is the density of propanol? Write only your answer below.

Answers

1. 16 mL

2. She need to find the mass, as density is mass divided by volume.

3. 0.75 g/cm^3

SECOND SCIENCE WORKSHEET:
Answer the following:
1:
Which type of cell has a cell wall?
2: What is the smallest part of any substance?
3:
What is used to see tiny objects?
4: What name is given to a substance where all the atoms are the
same?
5: What does the safety symbol with flames mean?
6: What gives the ability to do work?
7: Which part of the cell controls all cell activity?
8: By what process does a liquid change to a gas?
I

Answers

Answer:

1 animal cell

2?

3 mircoscope

4?

5 it means whenever you becareful

Match these solutions with their examples:
Liquid in liquid
Solid in liquid
gas in liquid
gas in gas
solid in solid
liquid in solid
Gas in solid

Examples
A. Air
B. seawater
C. marshmallow

Answers

Answer:

sea water

Explanation:

a sea water can match the following

PLZ ANSWER! MULTIPLE CHOICE!! MUST BE CORRECT!! I CANNOT GET THIS WRONG.

Answers

The answer is B, the second choice

Which best describes why NH4+ can form an ionic bond with CF?

Its outermost shell gains one or more electrons from CF.

Its positive charge is attracted to the negative charge of Cr.

It has a negative charge that is spread over the entire ion.

It has a nitrogen atom that is strongly attracted to Cr.

Answers

Answer:

Its positive charge is attracted to the negative charge of Cl-

Note: The correct question is given below:

Which best describes why NH4+ can form an ionic bond with Cl-?

Its outermost shell gains one or more electrons from Cl-.

Its positive charge is attracted to the negative charge of Cl-.

It has a negative charge that is spread over the entire ion.

It has a nitrogen atom that is strongly attracted to Cl-.

Its positive charge is attracted to the negative charge of Cl-.

Explanation:

An ammonium ion is a positively charged ion which is composed of a molecule of ammonia and a hydrogen ion which are in a coordinate covalent bond due to the lone pair of electrons of the nitrogen atom in the molecule ammonia. The chloride ion however, has an extra electron which gives it a negative charge.

An ionic bond is formed between two oppositely charged ions by a transfer of electrons from one atom to another. It usually occurs between non-metals and metals. However, that formed between ammonium ion and chloride ion is between non-metals entirely.

Due to electrostatic attraction between the oppositely charged ions, an ionic bond is formed between ammonium ion, NH4+, and chloride ion, Cl-.

Which is the molecular shape of water, H20, according to the VSEPR theory?
A. Bent
B. Tetrahedral
C. trigonal pyramidal
D. Trigonal planar

Answers

Answer:

the answer is A

Explanation:

How are convalent molecules named?

Answers

Covalent compounds are named by using numerical prefixes to identify the number of atoms in the molecule. E.g. Mono, Di, tri, tetra, etc.

In the naming, never use mono- for the first element.

The first element keeps its name.

The second element always end in the suffix -ide.

Drop the double vowel for the prefix and the element of the second element in the compound.

Hope this helped!

7. Which of the following is unlikely to
happen to zinc?
A) It is rolled into sheets.
B) It is used to coat a steel hull.
C) It is used in a battery.
D) It is used as an insulator.

Answers

Answer:D) it is used as an insulator

Explanation:

Astronomers observed that the orbit of Uranus was not uniform. Therefore, they hypothesized the existence of another planet. This is an example of scientific investigation being led by _____.

Inductive Reasoning
Deductive Reasoning

Answers

Answer:

This is an example of scientific investigation being led by inductive reasoning.

Explanation:

Inductive reasoning is the type of reasoning used to make broad generalizations from specific observations. We have certain pieces of data and make conclusions based on them. In the given example, astronomers have made a specific observation - that the orbit of Uranus isn't uniform. Based on that fact, they made a broader conclusion - that there is another planet. There are probably more things that could lead to the same conclusion.

The opposite is deductive reasoning, where a person starts off with a broad generalization and tries to make specific, logical conclusions based on it.

_________feedback is a type of feedback in which a system is triggered to produce an output.

Answers

Answer:

positive

Explanation:

Answer:

Positive feedback is a type of feedback in which a system is triggered to produce an output.





Explanation:

Have a great rest of your day
#TheWizzer

Which things are larger than cells? Put an X next to (or highlight) the things that are generally larger than a typical animal or plant cell.


_____thickness of a leaf ____grain of salt
_____atom _____protein molecule
_____width of hair x DNA
_____piece of sawdust _____eye of an ant
_____Water molecule _____tiny seed
_____bread crumb _____larva of a tiny fruit fly
_____bacteria _____period at end of sentence _____ virus
_____speck of pepper _____chromosome _____ frog embryo _____dust mite _____point of a pin _____ flea egg

Answers

Answer:

Explanation:

x thickness of a leaf x grain of salt

_____atom _____protein molecule

x width of hair x DNA

x piece of sawdust x eye of an ant

_____Water molecule x tiny seed

x bread crumb x larva of a tiny fruit fly

x bacteria x period at end of sentence _____ virus

x speck of pepper _____chromosome x frog embryo x dust mite xpoint of a pin x flea egg

a gas tank is under 1 atm pressure at room temperature. if the temperature halved,what will happen to the pressure ​

Answers

Answer:

The pressure will also be halved.

Explanation:

Gay-Lussac's law states that the relationship between temperature and pressure is directly proportional to each other. If the temperature goes up, so will the pressure.

What information can a foliated metamorphic rock provide you about the conditions under which it formed?

Answers

A foliated rock forms when the minerals are realigned due to the presence of high temperature and pressure. The minerals align in such a way that the axes are directed to where the pressure was applied.

Determine which equations you would use to solve the following problem: Calculate the amount of heat needed to change 20.0 g of ice at -10.0°C to water at 89.0°C.

Answers

Answer:

Q = 4019.4 J

Explanation:

Given data:

Mass of ice = 20.0 g

Initial temperature = -10°C

Final temperature = 89.0°C

Amount of heat required = ?

Solution:

specific heat capacity of ice is 2.03 J/g.°C

Formula:

Q = m.c. ΔT

Q = amount of heat absorbed or released

m = mass of given substance

c = specific heat capacity of substance

ΔT = change in temperature

ΔT = T2 - T1

ΔT =  89.0°C - (-10°C)

ΔT = 99°C

Q = 20.0 g ×2.03 J/g.°C × 99°C

Q = 4019.4 J

How many moles of hydrogen
are in 3.7 moles of C8H11 NO2?

Answers

40.7 because I know

Analysis of a sample of an oxide of nitrogen gave 47% of nitrogen.What is the empirical formula of the oxide?

Answers

Answer:

N2O

Explanation:

hope am right.....

Calculate the speed for a car that went a distance of 150 kilometers in 2 hours time. btw this is science

Answers

Answer:

The speed of the car is 75 km per hour

Explanation:

Speed is distance over time so 150 km divided by 2 hours is 75km per hour.

Please mark brainliest!!! Thanks.

Other Questions
What is your favorite story from childhood or from a recent time Sea-Floor Spreading1. The arrows on the figure show the ocean floor spreading from the ridge. What are three kinds of evidence scientists have found to support this idea?A. B. C. I NEED HELP an essay about your favourite cousin in french What school taught you to be a captain in Timothy of The cay In the number 707B47.B is a prime number.If the number is rounder off to 3sf its value is 708000 what is the biggest value of B "Write the equation of the line that is perpendicular to the line x - 4y = 20 and passes through the point (2, -5)." Thank you in advance! im having trouble figuring out what this question means |7| + -4=? Which of the following offers the least price per ounce of shampoo? A) $6 for 8 ounces of shampooB) $4 for 5 ounces of shampoo C) $8 for 12 ounces of shampoo D) $12 for 16 ounces of shampoo 10._________produces pollens and______develops into the fruit. Help me pls Use your ideas and knowledge to list and answer questions about civic duties and responsibilities.Answer each of the following questions with at least two complete sentences:4. What does it mean to be a good citizen?5. What is the difference between a civic duty and a civic responsibility? Be sure to give an example for each to help explain.6. When have you experienced a civic duty or responsibility? You may describe the example you wrote in your CAP file.7. Why is it important to a community for people to have good citizenship?8. What could happen if people do not fulfill a civic duty or responsibility? Give a specific example. identify the slope of the line. then identify a point the line passes through: 1. y - 2 =1/4(x - 5)2. y-7=-3(x+6) What composes a photosystem? Identify one type of rhetorical devices used in paragraph and what sentence is it?Now I am not going to stand in front of all of you today and take credit for what is happening now. I cannot do that. But I want to take credit for telling you how to do the same thing, and when you scream, friends, I know you will be heard. And you will be heard now. Angela bought gifts for her friends, and each gift costs 10$. Let y represent the total cost and x represent the number of gifts. Write an equation to represent the proportional relationship between the total cost and the number of the gifts she bought. Which type of mining is likely the least harmful to the environment?a. surface miningb. placer miningc. subsurface miningd. none of the above what is an equation for the translation of y=|x| left 7 units? What happens when electrons inside anatom get excited?A. They stay in their current energylevelB. They jump down an energy leveland absorb energy in the processC. They jump up an energy level andrelease energy in the process Am I right vote you brainiest i am in doubt in this task Hi there~! 18 points~ What happened after slavery? Put it in your own words please.