Use a calculator to find cos 149° rounded to the nearest hundredth. Identify the angle of depression

Answers

Answer 1

The value of cos 149 degree as calculated from the calculator is found out to be -0.857167301.

Which on round off is , -0.85.

The formula to calculate the angle of depression is , θ = tan-1 (Opposite Side/Adjacent Side) .

Therefore, the AOD for cos149 degree is found out to be as ,

α = arctan(vertical distance / horizontal distance)

α = arctan(10 / 11.998)

α = arctan(0.83347224537423)

α = 0.69482025147278 ° ≈ 0.69 °

The angle of depression is defined as the point of meeting of a horizontal line with the line between the item and the observer's eye. This angle is determined by two factors , which are their height and distance.  If the item is below the observer's level, the angle produced between the horizontal line and the observer's line of sight is known as the angle of depression.

To learn more about round off

brainly.com/question/11336588

#SPJ4


Related Questions

Given: PS bisects angle RST, 2SP=3SQ, 2ST=3SR

Prove: Triangle STP ~ triangle SRQ

Answers

The Triangle STP is similar to Triangle SRQ.

We can prove that triangle STP is similar to triangle SRQ using the Angle Bisector Theorem and the ratios of the sides of the triangles.

The Angle Bisector Theorem states that if point P bisects angle RST, then the ratio of the length of the side ST to the length of the side SR is equal to the ratio of the length of the side PT to the length of the side PQ.

In this case, we are given that 2SP = 3SQ and 2ST = 3SR.

Dividing both sides of the equation 2SP = 3SQ by 2 and both sides of the equation 2ST = 3SR by 2, we get:

SP/PQ = 3/2 and ST/SR = 3/2

As the ratio of the length of the side ST to the length of the side SR is equal to the ratio of the length of the side PT to the length of the side PQ.

Therefore, triangle STP is similar to triangle SRQ.

It can also be proven using the fact that PS bisects angle RST which means that the angle PST = PSR. And if two angles of two triangles are equal and the sides are in proportion then the two triangles are similar.

Read more about Similarity of Triangles:

https://brainly.com/question/29191745

#SPJ4

Solve for w
Reduce any fractions to lowest terms. Don't round your answer, and don't use mixed fractions
53w+13<56w+16

Answers

53w + 13 < 56w + 16

Subtract 13
53w < 56w + 3

Subtract 56w
-3w < 3

Divide by -3 and flip sign
w > -1

Find the centre focus,vertex,directrix and axis of each parabola and sketch the graph? (x-1)² = y+2​

Answers

Answer:

Step-by-step explanation:

The equation for a parabola is of the form y = ax^2 + bx + c, where a, b, and c are constants. The graph of a parabola is a U-shaped curve that is symmetrical about a line called the axis of symmetry.

In the equation (x-1)^2 = y+2, we can rewrite it as y = (x-1)^2 - 2. This is the standard form of a parabola with a = 1, b = 0, and c = -2.

The vertex of the parabola is the point on the graph where the parabola reaches its highest or lowest point. For a parabola in standard form, the vertex is always of the form (h,k), where h and k are the values of x and y, respectively, at the vertex. The vertex of this parabola is (1,-2).

The axis of symmetry of the parabola is a line that divides the parabola into two mirror images. For a parabola in standard form, the axis of symmetry is always the line x = h, where h is the value of x at the vertex. The axis of symmetry of this parabola is the line x = 1.

The directrix of a parabola is a line that is used to define the parabola. For a parabola in standard form, the directrix is always the line y = k + p, where k and p are constants and p is the distance from the vertex to the directrix. The directrix of this parabola is the line y = -2 + p, where p is the distance from the vertex to the directrix.

The focus of a parabola is a point on the axis of symmetry that is used to define the parabola. For a parabola in standard form, the focus is always the point F(h,k+p), where h and k are the values of x and y, respectively, at the vertex, and p is the distance from the vertex to the directrix. The focus of this parabola is F(1,-2+p), where p is the distance from the vertex to the directrix.

To sketch the graph of this parabola, we can start by plotting the vertex at (1,-2). Then we can draw the axis of symmetry, which is the line x = 1. Next, we can choose a value for p and draw the directrix y = -2 + p. Finally, we can use the vertex and focus to plot points on either side of the axis of symmetry, and connect these points to form the U-shaped curve of the parabola.

[asy]

unit size(1cm);

real p = 1.5;

pair F, V;

F = (1,-2+p);

V = (1,-2);

draw((-2,0)--(4,0));

draw((0,-4)--(0,4));

draw((-2,V.y)--(4,V.y),dashed);

draw((F.x,p)--(F.x,-4),dashed);

label("$x$", (4,0), E);

label("$y$", (0,4), N);

label("$y = (x - 1)^2 - 2$", (4,-3), E);

a dot("$F$", F, NW);

a dot("$V$", V, S);

label

Does (1, 10) make the inequality y ≤ 5x + 4 true?
yes
no?

Answers

Answer:

No, it is not true

Step-by-step explanation:

y ≤ 5x + 4

We know a point is (1,10), we need to put the 1 in for x and the 10 in for y to see if the inequality is true or not!

10 ≤ 5(1) + 4

10 ≤ 5 + 4

10 ≤ 9

This is not True!

Answer: nope

Step-by-step explanation:

According to the linear regression model, the men’s world record mile run time in 1940 would have been how many seconds?

Answers

The men’s world record mile run time in 1940 would have been 10.454 seconds

Here, the equation of the linear function that best fits the data (the line of best fit) is Finishing time = 10.878 - 0.0106(Year after 1900)

Let k be the finishing time in seconds and t be the number of years after 1900

So, the equation of regression line becomes,

k = 10.878 - (0.0106) t

To find the the men’s world record mile run time in 1940 first we find the the number of years (t)

t = 1940 - 1900

t = 40 years

So, the finishig time (k) would be,

k = 10.878 - (0.0106) × 40

k = 10.454 seconds

Therefore, the finishing time was 10.454 seconds

Learn more about an equation here:

https://brainly.com/question/649785

#SPJ4

Solve the following problem.
1. If a is indirectly proportional to b, then a=k/b, where k is a constant or fixed number. If a=8 when b=6, find the value of k.

Using the value of k in number 1, find:
2. a if b=3
3. a if b=4
4. a if b=12
5. a if b=1.5
6. a if b=3.6
7. a if b=4.8
8. b if a=3
9. b if a=4
10. b if a=4.5
11. b if a= 4.8
12. b if a=3.6
13. b if a=6

Answers

Answer:

see explanation

Step-by-step explanation:

given the equation

a = [tex]\frac{k}{b}[/tex]

to find k use the given condition a = 8 when b = 6 , then

8 = [tex]\frac{k}{6}[/tex] ( multiply both sides by 6 to clear the fraction )

48 = k

a = [tex]\frac{48}{b}[/tex] ← equation of variation

2

if b = 3

a = [tex]\frac{48}{3}[/tex] = 16

3

if b = 4

a = [tex]\frac{48}{4}[/tex] = 12

4

if b = 12

a = [tex]\frac{48}{12}[/tex] = 4

5

if b = 1.5

a = [tex]\frac{48}{1.5}[/tex] = 32

6

if b = 3.6

a = [tex]\frac{48}{3.6}[/tex] = 13.3333.. = 13 [tex]\frac{1}{3}[/tex]

7

if b = 4.8

a = [tex]\frac{48}{4.8}[/tex] = 10

for the remaining questions, rearrange the equation with b as the subject

a = [tex]\frac{48}{b}[/tex] ( multiply both sides by b )

ab = 48 ( divide both sides by a )

b = [tex]\frac{48}{a}[/tex]

8

if a = 3

b = [tex]\frac{48}{3}[/tex] = 12

9

if a = 4

b = [tex]\frac{48}{4}[/tex] = 12

10

if a = 4.5

b = [tex]\frac{48}{4.5}[/tex] = 10.666... = 10 [tex]\frac{2}{3}[/tex]

11

if a = 4.8

b = [tex]\frac{48}{4.8}[/tex] = 10

12

if a = 3.6

b = [tex]\frac{48}{3.6}[/tex] = 13.333... = 13 [tex]\frac{1}{3}[/tex]

13

if a = 6

b = [tex]\frac{48}{6}[/tex] = 8

~50 POINTS~ don’t explain.
A
B
C

Answers

Answer:

C

Step-by-step explanation:

The angles at point A have to be congruent so that you have two congruent angles. and one congruent side, which give SAA.

From the image, we can see than angle B and angle D are congruent. We also know that line AC is congruent to itself since it shared between the two triangles. Since we need one more angle, that angle has to be angle A.

The answer is C for this question

What type of a polynomial is 4 2x3?

Answers

The polynomial 4 2x3 is a degree 3 polynomial, also known as a cubic polynomial.

What is polynomial?

Polynomial is an expression consisting of variables, constants, and coefficients. It is an algebraic expression that can contain exponents, fractions, multiplication, addition, and subtraction. Polynomials are used to model many real-world situations, such as the volume of a cylinder or the area of a triangle. The degree of the polynomial is determined by the highest exponent of the variables in the expression. Polynomials can be divided, factored, and manipulated using the rules of algebra.

It consists of three terms and its general form is

ax³ m + bx² + cx + d, where a, b, c, and d are constants

and x is the variable. In this case,

a = 4, b = 2, c = 0 and d = 0,

so the polynomial is 4x³ + 2x².

To know more about polynomial click-
https://brainly.com/question/15702527
#SPJ4

What is relation of log and e?

Answers

The relationship between the natural logarithm (ln) and the natural exponential (e) is given by the equation ln(x) = e^x. This equation is known as the exponential form of the natural logarithm.

To explain this relationship, let's start with a simple example. Suppose we have a number x, and we want to find its natural logarithm. To do this, we can use the following equation:

ln(x) = e^x

This equation states that the natural logarithm of x is equal to the natural exponential of x. In other words, we can calculate the natural logarithm of x by raising e to the power of x. To illustrate this with an example, suppose we want to calculate the natural logarithm of 10. We can do this using the equation above as follows:

ln(10) = e^10

Now, we can use a calculator to calculate e^10. If we do this, we get the result of 22,366.48. Therefore, the natural logarithm of 10 is equal to 22,366.48.

The relationship between the natural logarithm and the natural exponential is important because it allows us to easily calculate the natural logarithm of any number. All we have to do is raise e to the power of that number, and the result will be the natural logarithm of that number. This is a very useful tool in mathematics and can be used to solve many problems involving logarithms.

Learn more about natural logarithm here:

https://brainly.com/question/30085872

#SPJ4

what is -2/5 plus 4/3

Answers

The required solution to the given statement is 14/15.

What is the Least Common Multiple(LCM)?

The least common multiple is defined as the least positive integer that is dividable by both given numbers.

A group's Least Common Multiple (LCM) is the smallest number that is a multiple of all the numbers. For example, the LCM of 4 and 5 is 20; 20 is the smallest number that is both a multiple of 4 and a multiple of 5

The statement is given in the question below as:

-2/5 plus 4/3

Here "plus" represents the addition sign (+)

So, the algebraic form of the above statement will be as:

⇒ -2/5 + 4/3

Take the LCM between the fractions, we get

⇒ ( -6 + 20)/15

⇒ 14/15

This means 14/15 is obtained from -2/5 plus 4/3.

To learn more about the Least Common Multiple(LCM) here :

https://brainly.com/question/17256135

#SPJ1

Unit 1 geometry basics Homework 2
pls help! i’ll mark brainliest

Answers

The value of AB= 24 BD is congruent to BC. BD=BC

BD = 5x – 26, BC = 2x + 1, and AC = 43

How to find value of AB?From the diagram , AC=AB+BCTo find out , we need to find  BC first . For that we have to find out xWE know that BD=BC, using that we solve for x5X-26=2X+1SUBSTRACT 2X3X-26=1ADD 263x=27x=9Now we plug in 9 for x  and find out BCBC=2x+1BC=2(9)+1BC=19We know AC= 43AC=AB+BC43=AB+19subtract 19AB=24

To learn more about find value of AB refers to:

brainly.com/question/11923213

#SPJ1

PLEASE HELP SOON

1. Solve the system. 3x+y = 10 y = 6x+1 Enter your answer by filling in the blanks. The solution is ( , )

2. Solve the system. 6x - y = -15 x + 2y = 17 Enter your answer as a coordinate pair in the blank.

Answers

Answer:

1. ( 1,7)

2. (17, 39)

Step-by-step explanation:

1.  Replace all occurrences of y with 6x+1, and we get

9x + 1 = 10

x = 1

y = 6x + 1

y = 7

So, the answer for number 1 is (1,7)

2. 6x - y = -15x + 2y = 17

We subtract 2y and get

6x - 3y = 15x = 17

Replace all occurrences of x with 17, and we get

102 −3y = −15

x = 17

y = 39

So, the answer for number 2 is (17, 39)

Does there seem to be a relationship between which type of book her friends like best and the number of books they read this month?

Answers

Based on the two-way table, there seems to be a relationship between the type of books Julia's friends like best and the number of books they have read this month, A. Yes, because those who like fiction read one book at a rate four times that of those who read non-fiction books.

What is a two-way table?

A two-way table, also called a contingency table, is a statistical table that shows the observed frequency for two variables.

The rows of a two-way table indicate one category and the columns indicate the other category.

For instance, based on the two-way table, one can observe that 80% of Julia's friends prefer fiction while 20% prefer non-fiction.

Among those who read 1 book this month, 80% read fiction against 20% who read non-fiction.  Similarly, among those who read 2 books this month, the same 80% read fiction against 20% who read non-fiction.

The number of students who prefer fiction = 60

The number of students who prefer non-fiction = 15

The number of fiction-preferring students who read 1 book this month = 40, which is 80% of the total (40/50 x 100).

The number of fiction-preferring students who read 2 books this month = 20, which is 80% of the total (20/25 x 100).

Thus, we can conclude that Option A is correct.

Learn more about the two-way table at https://brainly.com/question/16148316

#SPJ1

Question Completion:

The Two-way Table:

                                       Read 1 book         Read 2 books     Total

Prefer fiction books               40                            20              60

Prefer non-fiction books        10                              5               15

Total                                       50                            25              75

together Larry and Lenny have $\$$35. Larry has two-fifths of Lenny's amount. How many more dollars than Larry does Lenny have

Answers

The answer which we get after calculating from the data given is that  Larry has 15 dollars more than Lenny.

Let the amount which Lenny is having be x

then the amount which Larry is having will be (2/5)x

and on combining them it makes $35 .

Which means,  x + 2x/5 = 35

On simplifying this equation we will get ,

(7/5)x= 35   ,

multiplying both the sides by 5/7

x= (5/7)*35 = $25

Therefore , Lenny is having 4 25.

So Larry must be having ,  $(35 - 25) = $10

So , we can conclude that Lenny has more dollars. The difference is of 15 dollars.

To learn more about equations

brainly.com/question/29168024

#SPJ4

Factorise fully the following:
a) x² + x
b) 3x-9x²
c) 7x³ - 35x
d) 4x³ + 24x²

Answers

A.
Pull out the x
X(x+1)

B.
Pull out 3x
3x(1 - 9x)

C.
Pull out 7x
7x(x^2 - 5)

D.
Pull out 4x^2
4x^2(x + 6)

The correct factorization are as follows:

(a) x² + x = x(x + 1)

(b) 3x-9x² = 3x(1 - 3x)

(c) 7x³ - 35x = 7x(x^2 - 5)

(d) 4x³ + 24x² = 4x^2(x + 6)

What do you mean by "factorization"?

The most crucial step in factorization is to identify the terms points of commonality. Divide each term by the common factor between them, then multiply the result by the entire expression to maintain the value.

One of the key techniques for reducing an algebraic or quadratic equation to a simple form is factorization. Thus, one should be familiar with factorisation formulas in order to simplify the complex problem.

Additionally, you can always multiply your response to see if you end up with the same result as your starting point.

Step by step solution:

(a): x² + x, [Here both terms have 'x' in common]

=x( (x²/x) + (x/x) )

= x(x+1)

(b): 3x - 9x², [Here both terms have '3x' in common]

=3x( (3x/3x) - (9x²/3x) )

= 3x(1-3x)

(c): 7x³ - 35x, [here both terms have '7x' in common]

=7x( (7x³/7x) - (35x/7x) )

= 7x(x²-5)

(d): 4x³+ 24x² [here both terms have 4x² in common]

=4x²( (4x³/4x²) + (24x²/4x²) )

= 4x²(x+6)

To know more about "factorization" here:

brainly.com/question/25829061

Tickets for all of the described charity raffle games cost $2 per ticket .identify the games in which a person who buys a ticket for each game every day for the next 400 days could expect to lose less than a total of $200

Answers

Answer: To determine the games in which a person who buys a ticket for each game every day for the next 400 days could expect to lose less than a total of $200, we need to find the games in which the probability of winning is greater than the probability of losing.

Since the tickets for all of the games cost $2 per ticket, the probability of winning any given game is equal to the prize money divided by the ticket cost. For example, if the prize money for a game is $10, the probability of winning is $10/$2 = 1/2.

If the probability of winning a game is greater than the probability of losing, the expected value of the game is positive, which means that the person can expect to win more than they lose over time. On the other hand, if the probability of winning is less than the probability of losing, the expected value of the game is negative, which means that the person can expect to lose more than they win over time.

Therefore, to determine which games the person could expect to lose less than $200 in total, we need to find the games in which the prize money is greater than $2 per ticket.

Step-by-step explanation:

The volume of a cylinder is 60 cubic centimeters. What is the number of cubic centimeters in the volume of the sphere it circumscribes

Answers

Call the radius of the cylinder and sphere, r And the height  of the cylinder  = 2r

How to Calculate Volume in Cubic Centimeters?Calculating volume is just another way of saying that you're measuring the amount of space inside a three-dimensional object. You can use standardized formulas for calculating the volume of shapes like cubes, cylinders and spheres, as long as you know their basic measurements.So60  =  pi * r^2 * 2r30 =  pi * r^330/pi  =  r^3[30/pi]^1/3  =  rSo...the volume of the sphere is(4/3)pi [ (30/pi)^1/3 ]^3  =(4/3) pi * 30/pi  =40 cm^3A cubic centimetre (or cubic centimeter in US English) (SI unit symbol: cm3; non-SI abbreviations: cc and ccm) is a commonly used unit of volume that corresponds to the volume of a cube that measures 1 cm × 1 cm × 1 cm. One cubic centimetre corresponds to a volume of one millilitre.How to Work out Volume with Cubic Centimetres. If a container was filled with water and it had a length of 20 cm, a height of 5 cm and a depth of 4 cm to work out the volume of water you would need to multiply all 3 numbers together. 20 cm x 5 cm x 4 cm = 400 cm³

To learn more about Volume in Cubic Centimeters refers to:

brainly.com/question/463363

#SPJ4

List the key features of the quadratic function y = -x^(2) + 4x - 3

A) x-intercepts: (1,0) and (3,0), y-intercept: (0,3), vertex: (2,–1)

B) x-intercepts: (–1,0) and (–3,0), y-intercept: (0,–3), vertex: (2,–1)

C) x-intercepts: (1,0) and (3,0), y-intercept: (0,–3), vertex: (–1,2)

D) x-intercepts: (1,0) and (3,0), y-intercept: (0,–3), vertex: (2,1)

Answers

The key features of the quadratic function y = -x² + 4x - 3 include the following: D) x-intercepts: (1, 0) and (3, 0), y-intercept: (0, –3), vertex: (2, 1).

What is y-intercept?

In Mathematics, the y-intercept of any graph such as a quadratic function, generally occur at the point where the value of "x" is equal to zero (x = 0).

When x = 0, the y-intercept is given by;

y = -x² + 4x - 3

y = -0² + 4(0) - 3

y = -3

Therefore, the y-intercept of this quadratic function y = -x² + 4x - 3 is given by the ordered pair (0, -3).

What is the x-intercept?

In Mathematics, the x-intercept can be defined as the point at which the graph of a quadratic function crosses the x-coordinate and the value of "y" is equal to zero (0).

By critically observing the graph of this quadratic function y = -x² + 4x - 3, the x-intercept include the following:

Ordered pair = (1, 0).Ordered pair = (3, 0).

In conclusion, the vertex of this quadratic function y = -x² + 4x - 3 is (2, 1).

Read more on y-intercept here: brainly.com/question/6240745

#SPJ1

HELP!!!

What is the slope of the line containing (-3, 5) and (6, -1)?
A. 2/3
B. 1
C. -1
D. -2/3

Answers

Answer:Slope is -2/3

Step-by-step explanation:

What you do is use the formula y2-y1/x2-x1.

y1 and y2 are at the end of the parenthesis so y1 is 5 and y2 is -1.

x1 and x2 are at the beginning of the parenthesis so x1 is -3 and x2 is 6.

Then you put it into the formula:

-1-5/6-(-3)

This then equals -2/3.

-2/3 is the answer.

10.)The charge for electricity consumption, E,
is partly constant and partly varies as the
number N of units used. The charge for 163
units is N453.80 while the charge for 42 units
is #139.20.
a Calculate the charge per unit of
electricity.
b Obtain a formula for E in terms of N.

Answers

On solving the provided question, we can say that - the charge for 42 units = is $139.20; so, charge per unit is 139.20/42 = $3.3142857143

What is unitary method ?

The unit technique is an approach to problem-solving that involves first determining the value of a single unit, then multiplying that value to determine the required value. The unit method, to put it simply, is used to extract a single unit value from a supplied multiple. For instance, 40 pens would cost 400 rupees, or the price of one pen. The process for doing this may be standardized. a single country. anything that has an identity element. (mathematics, algebra) (Linear algebra, mathematical analysis, mathematics of matrices or operators) Its adjoint and reciprocal are equivalent.

here,

the charge for 42 units = is $139.20.

so, charge per unit is 139.20/42 = $3.3142857143

To know more about unitary bvisit:

https://brainly.com/question/28276953

#SPJ1

1. True or False: The solution you get from substitution is the same as the solution you would get
from graphing. *
False
True

2. For substitution, we want *
(1 Point)
a. both equations to be in standard form Ax + By = C
b. equations with negative numbers
C. at least one equation to be y= or x=
d. equations with positive numbers

Answers

answer:

my answer to the first one would be false

my answer to the second would be a

Reasonable Time: Algorithms with a polynomial efficiency or lower (constant, linear, square, cube, etc.) are said to run in a reasonable amount of time. Unreasonable Time: Algorithms with exponential or factorial efficiencies are examples of algorithms that run in an unreasonable amount of time. Your school is considering running the group raffle at an upcoming assembly to give away a prize. Write a brief explanation of what advice you would give them.

Answers

Unreasonable Time is the nest option for running the group raffle at an upcoming assembly to give away a prize.

As given that;

Reasonable Time: Algorithms with a polynomial efficiency or lower (constant, linear, square, cube, etc.) are said to run in a reasonable amount of time.

Unreasonable Time: Algorithms with exponential or factorial efficiencies are examples of algorithms that run in an unreasonable amount of time.

Your school is considering running the group raffle at an upcoming assembly to give away a prize.

We have to write a brief explanation of what advice you would give them.

We can use the unreasonable time because  running the group raffle at an upcoming assembly to give away a prize cannot complete their work is the given amount of time.

To learn more about Reasonable and Unreasonable Time link is here

brainly.com/question/30186336

#SPJ4

The six sides of a number cube are labeled 1,2,3,4,5,and six you flip a coin and roll the number cube what is the theoretical probability that the coin lands on heads and u roll the cube and the number is less then 5. Write your answer as a fraction

Answers

The theoretical probability that the coin lands on heads and roll the cube and the number are less than 5 is 1/3.

What is an event?

An event is a collection of experiment results (a subset of the sample space) to which a probability is ascribed in probability theory.

There are 6 faces of a cube.

The numbers less than 5 on a cube are 1, 2, 3, 4.

The number of favorable outcomes is 4.

The total number of outcomes is 6.

The probability of getting less than 5 is

favorable outcome/ total number of outcomes = 4/6 = 2/3.

The number of faces of a coin is 2.

The number of heads of a coin is 1.

The probability of getting head is 1/2.

The probability of getting less than 5 in a roll and head in the coin is

2/3 × 1/2 = 1/3.

To learn more about probability, click on the below link:

https://brainly.com/question/9504188

#SPJ4

An investment portfolio is shown below.


Investment Amount Invested ROR
Stock A $1,800 1.5%
Stock B $4,600 3.7%
Stock C $580 11.2%
Stock D $1,122 −2.8%


Using technology, calculate the weighted dollar amount of Stock C.
$27.00
$64.96
$170.20
$184.00

Answers

The required weight of the dollar amount of Stock C is $64.96.

The Correct option is (B).

What is simplification?

In mathematics, the operation and interpretation of a function to make it simple or easier to grasp is known as simplifying, and the process is known as simplification.

Given:

Investment Amount Invested ROR

Stock A     $1,800     1.5%

Stock B     $4,600     3.7%

Stock C     $580        11.2%

Stock D     $1,122      −2.8%

According to the question,

Weight of dollar amount of Stock C

= 580 × 11.2%

= 580 x 0.112

= $64.96

Hence, the required weight is $64.96.

Learn more about simplification here:

brainly.com/question/12501526

#SPJ1

man travels 60 miles to work at an average speed of 40mph. He travels home the same route at an average speed of 60mph. What is the average speed of his round trip

Answers

Answer:1881 6040mph 18x

A balloon ascending at a rate of 12 ft/s is at a height of 80 ft above the ground when a package is dropped. How long does it take the package to reach the ground

Answers

The time taken by the package to reach the ground will be 5.45 seconds.

What governs motion, according to Newton?

The motion of an object is related to the forces acting on it by Newton's laws of motion. According to the first law, unless a force acts on an object, it will not alter its motion. According to the second law, an object's force is determined by multiplying its mass by its acceleration. According to the third law, when two objects interact, they exert equal-sized and opposite-direction forces upon one another.

Solution:-

vo=12m/s

h=80m=yo

Then,

[tex]y-yo= vot-1/2gt^2[/tex]

⇒[tex]0-80m=(12m/s)t - 1/2(9.8m/s^2)t^2[/tex]

⇒[tex](4.9m/s^2)t^2-(12m/s)t-80m=0[/tex]

⇒[tex](4.9m/s^2)t^2-(12m/s)t-80m=0[/tex]

⇒[tex]t=5.45s, t=-3.00s[/tex]

∴[tex]t=5.45s[/tex]

To know more about first law visit:-

brainly.com/question/15410544

#SPJ4

20 POINTS!!!!!!!!!!!!!!!!!

Answers

The measure of angle is, 62°.

What is Complementary angle?

The sum of two or more angle is 90 degree then the angle is called the complementary angle.

We have to given that;

Supplement of an angle is 6 more than 4 times of its complement.

Now,

Let measure of an angle = x

So, By given condition, we can formulate;

The supplement of an angle = 180 - x

And, The complement an angle = 90 - x

Hence, We get;

⇒ (180 - x) = 6 + 4 (90 - x)

Solve for x as;

⇒ 180 - x = 6 + 360 - 4x

⇒ 4x - x = 366 - 180

⇒ 3x = 186

⇒ x = 62°

Learn more about the complement angle visit:

https://brainly.com/question/16281260

#SPJ1

brainy plot and labels points P (-5/2), Q (2 3/4), R(1.25), and S(-3.5) on the number line

Answers

Answer:

Step-by-step explanation:

To plot points P (-5/2), Q (2 3/4), R(1.25), and S(-3.5) on a number line, we can simply draw a horizontal line and mark off the positions of the points. The numbers on the number line will represent the values of the x-coordinates of the points.

[asy]

unit size(1cm);

draw((-7,0)--(5,0));

draw((-7,0)--(-7,1)--(5,1)--(5,0)--cycle);

dot("$P$", (-5/2,0), S);

dot("$Q$", (2 3/4,0), S);

dot("$R$", (1.25,0), S);

dot("$S$", (-3.5,0), S);

[/asy]

On the number line, point P is located at -5/2, point Q is located at 2 3/4, point R is located at 1.25, and point S is located at -3.5.

What is the perimeter of 4?

Answers

The perimeter of a shape with 4 sides is equal to the sum of its sides multiplied by itself, which in this case is 4 multiplied by 4, resulting in a perimeter of 16.

Step 1: Calculate the length of each side by multiplying 4 by 4.

Step 2: Add the lengths of each side together to get the perimeter.

Step 3: The perimeter of the shape with 4 sides is equal to 16.

The perimeter of a shape is the sum of the lengths of its sides. To calculate the perimeter of a shape with 4 sides, you need to find the length of each side. To do this, you can multiply the length of one side by itself. For example, if the length of one side is 4, the length of each side would be 4 multiplied by 4, which is 16. Therefore, the perimeter of a shape with 4 sides is equal to 16. To calculate the perimeter of a different shape with an unknown number of sides, you can add up the lengths of each side to get the total perimeter. This is a useful way to measure the size of a shape and can be used to calculate the area of a shape by dividing the perimeter by the number of sides.

Learn more about perimeter here

https://brainly.com/question/6465134

#SPJ4

Determine the range of f(x) = x + 51.
A-{yl-00 B-{y 1-5 C-{y|0 ≤y <∞0}
D-{y | 5 ≤y < 00}

Answers

Answer:

90670998.89999999999999

Other Questions
TRUE OR FALSE it is important for project managers to understand that every cost estimate is unique. What do endorphins feel like? 4.5 code practice phython code answers Help? Tysm if you do :>Using the graph above, what was the cost of the most expensive invasive species?200 billion US dollars10 billions US dollars148 billion US dollars50 billion US dollars eight more than the product of a number 9 is equal to 7 What is the most important significance of meiosis? Why did Madison recommend a server-based network for SEAT?A) It provides centralized access to resources.B) It is simpler to expand.C) It is easier to operate.D) It is less expensive.E) It provides more security. what two places were known for having decentralized/ feudal governments in period 3 Which of the following account balances is carried forward to the next accounting period?a. accumulated depreciationb. depreciation expensec. dividendsd. sales revenue How many babies were born in concentration camps? In a cross join, all of the rows in the first table are joined with all of theO unmatched columns in the second tableO matched rows in the second tableO rows from the second tableO distinct rows in the second table 18 POINTS (dont answer icebrain)a.)b.)c.) What do you think about suppressing certain evidence because it has been obtained illegally? How does it relate to the Constitutional right to due process? Explain your point of view fully, giving examples to back yourself up. What is the chance in percentage (%) that the child being homozygous for the trait? What are two adaptations in plant cells that do similar things for plants as bones do for animals? HELP PLEAS THANK OYOU aseous ammonia chemically reacts with oxygen gas to produce nitrogen monoxide gas and water vapor. Calculate the moles of ammonia needed to produce 1.3 mole of water the leaf-like structure that protects a developing flower bud until it opens as a fully formed flower is called a what Alice is playing a game in which she will roll 4 6-sided dice at the same time. She gets 5 points for each die that shows an even result. Let x represent the total number of points awarded on any given toss of the dice. What is the expected value of x? A. 1/2 B. 2 C. 10 D. 15 E. 20 Homer, Lisa, and Moe are asked to remember pairs of words. Homer tries to accomplish this task by rehearsing the words over and over again. Lisa decides to create a narrative combining the words. Finally, Moe decides to imagine the objects interacting in some way. Who is likely to have the WORST memory for the words?a.Homerb.They will remember them equally well.c.Moed.Lisa Which anatomical feature would you expect to find in the fossil remains of a nocturnal species?a. short fingers and toesb. pointy teethc. long legsd. large eye orbits